About 4,6-difluoro-3,5-dimethyl-1H-pyridin-2-one;ethane
4,6-difluoro-3,5-dimethyl-1H-pyridin-2-one;ethane (PubChem CID 144823805) has the molecular formula C9H13F2NO
and a molecular weight of 189.20 g/mol. Its IUPAC name is 4,6-difluoro-3,5-dimethyl-1H-pyridin-2-one;ethane.
Molecular Properties
| Compound Name | 4,6-difluoro-3,5-dimethyl-1H-pyridin-2-one;ethane |
| PubChem CID | 144823805 |
| Molecular Formula | C9H13F2NO |
| Molecular Weight | 189.20 g/mol |
| Exact Mass | 189.10 |
| IUPAC Name | 4,6-difluoro-3,5-dimethyl-1H-pyridin-2-one;ethane |
| SMILES | CC.Cc1c(F)[nH]c(=O)c(C)c1F |
| InChI | InChI=1S/C7H7F2NO.C2H6/c1-3-5(8)4(2)7(11)10-6(3)9;1-2/h1-2H3,(H,10,11);1-2H3 |
| InChIKey | KCAZGUUCJFUJKG-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.20 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 4,6-difluoro-3,5-dimethyl-1H-pyridin-2-one;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-difluoro-3,5-dimethyl-1H-pyridin-2-one;ethane?
The IUPAC name of 4,6-difluoro-3,5-dimethyl-1H-pyridin-2-one;ethane (CID 144823805) is 4,6-difluoro-3,5-dimethyl-1H-pyridin-2-one;ethane.
What is the SMILES notation for 4,6-difluoro-3,5-dimethyl-1H-pyridin-2-one;ethane?
The canonical SMILES for 4,6-difluoro-3,5-dimethyl-1H-pyridin-2-one;ethane is CC.Cc1c(F)[nH]c(=O)c(C)c1F.
What is the InChIKey of 4,6-difluoro-3,5-dimethyl-1H-pyridin-2-one;ethane?
The InChIKey is KCAZGUUCJFUJKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7F2NO.C2H6/c1-3-5(8)4(2)7(11)10-6(3)9;1-2/h1-2H3,(H,10,11);1-2H3.
What are the key properties of 4,6-difluoro-3,5-dimethyl-1H-pyridin-2-one;ethane?
4,6-difluoro-3,5-dimethyl-1H-pyridin-2-one;ethane has a molecular weight of 189.20 g/mol, XLogP of 2.30, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-difluoro-3,5-dimethyl-1H-pyridin-2-one;ethane is sourced from PubChem (CID 144823805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).