C11H17N3O — CID 144823808
ethane;3,5,6-trimethyl-7H-pyrrolo[2,3-d]pyrimidin-2-one (PubChem CID 144823808) has the molecular formula C11H17N3O and a molecular weight of 207.28 g/mol. Its IUPAC name is ethane;3,5,6-trimethyl-7H-pyrrolo[2,3-d]pyrimidin-2-one.
| Compound Name | ethane;3,5,6-trimethyl-7H-pyrrolo[2,3-d]pyrimidin-2-one |
|---|---|
| PubChem CID | 144823808 |
| Molecular Formula | C11H17N3O |
| Molecular Weight | 207.28 g/mol |
| Exact Mass | 207.14 |
| IUPAC Name | ethane;3,5,6-trimethyl-7H-pyrrolo[2,3-d]pyrimidin-2-one |
| SMILES | CC.Cc1[nH]c2nc(=O)n(C)cc2c1C |
| InChI | InChI=1S/C9H11N3O.C2H6/c1-5-6(2)10-8-7(5)4-12(3)9(13)11-8;1-2/h4H,1-3H3,(H,10,11,13);1-2H3 |
| InChIKey | RNDSBISCCHDTLK-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 50.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.28 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |