About 2-aminopyrazolo[1,5-a]pyrimidine-3-carboxamide;2-ethyl-6-fluoro-3-phenylchromen-4-one
2-aminopyrazolo[1,5-a]pyrimidine-3-carboxamide;2-ethyl-6-fluoro-3-phenylchromen-4-one (PubChem CID 144824020) has the molecular formula C24H20FN5O3
and a molecular weight of 445.45 g/mol. Its IUPAC name is 2-aminopyrazolo[1,5-a]pyrimidine-3-carboxamide;2-ethyl-6-fluoro-3-phenylchromen-4-one.
Molecular Properties
| Compound Name | 2-aminopyrazolo[1,5-a]pyrimidine-3-carboxamide;2-ethyl-6-fluoro-3-phenylchromen-4-one |
| PubChem CID | 144824020 |
| Molecular Formula | C24H20FN5O3 |
| Molecular Weight | 445.45 g/mol |
| Exact Mass | 445.16 |
| IUPAC Name | 2-aminopyrazolo[1,5-a]pyrimidine-3-carboxamide;2-ethyl-6-fluoro-3-phenylchromen-4-one |
| SMILES | CCc1oc2ccc(F)cc2c(=O)c1-c1ccccc1.NC(=O)c1c(N)nn2cccnc12 |
| InChI | InChI=1S/C17H13FO2.C7H7N5O/c1-2-14-16(11-6-4-3-5-7-11)17(19)13-10-12(18)8-9-15(13)20-14;8-5-4(6(9)13)7-10-2-1-3-12(7)11-5/h3-10H,2H2,1H3;1-3H,(H2,8,11)(H2,9,13) |
| InChIKey | SMIQAQWGMXDGKY-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 129.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 445.45 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-aminopyrazolo[1,5-a]pyrimidine-3-carboxamide;2-ethyl-6-fluoro-3-phenylchromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminopyrazolo[1,5-a]pyrimidine-3-carboxamide;2-ethyl-6-fluoro-3-phenylchromen-4-one?
The IUPAC name of 2-aminopyrazolo[1,5-a]pyrimidine-3-carboxamide;2-ethyl-6-fluoro-3-phenylchromen-4-one (CID 144824020) is 2-aminopyrazolo[1,5-a]pyrimidine-3-carboxamide;2-ethyl-6-fluoro-3-phenylchromen-4-one.
What is the SMILES notation for 2-aminopyrazolo[1,5-a]pyrimidine-3-carboxamide;2-ethyl-6-fluoro-3-phenylchromen-4-one?
The canonical SMILES for 2-aminopyrazolo[1,5-a]pyrimidine-3-carboxamide;2-ethyl-6-fluoro-3-phenylchromen-4-one is CCc1oc2ccc(F)cc2c(=O)c1-c1ccccc1.NC(=O)c1c(N)nn2cccnc12.
What is the InChIKey of 2-aminopyrazolo[1,5-a]pyrimidine-3-carboxamide;2-ethyl-6-fluoro-3-phenylchromen-4-one?
The InChIKey is SMIQAQWGMXDGKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13FO2.C7H7N5O/c1-2-14-16(11-6-4-3-5-7-11)17(19)13-10-12(18)8-9-15(13)20-14;8-5-4(6(9)13)7-10-2-1-3-12(7)11-5/h3-10H,2H2,1H3;1-3H,(H2,8,11)(H2,9,13).
What are the key properties of 2-aminopyrazolo[1,5-a]pyrimidine-3-carboxamide;2-ethyl-6-fluoro-3-phenylchromen-4-one?
2-aminopyrazolo[1,5-a]pyrimidine-3-carboxamide;2-ethyl-6-fluoro-3-phenylchromen-4-one has a molecular weight of 445.45 g/mol, XLogP of 3.57, 3 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminopyrazolo[1,5-a]pyrimidine-3-carboxamide;2-ethyl-6-fluoro-3-phenylchromen-4-one is sourced from PubChem (CID 144824020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).