About 5-butan-2-yl-N-ethyl-N-propylpyrazin-2-amine;ethane;morpholine
5-butan-2-yl-N-ethyl-N-propylpyrazin-2-amine;ethane;morpholine (PubChem CID 144824938) has the molecular formula C19H38N4O
and a molecular weight of 338.54 g/mol. Its IUPAC name is 5-butan-2-yl-N-ethyl-N-propylpyrazin-2-amine;ethane;morpholine.
Molecular Properties
| Compound Name | 5-butan-2-yl-N-ethyl-N-propylpyrazin-2-amine;ethane;morpholine |
| PubChem CID | 144824938 |
| Molecular Formula | C19H38N4O |
| Molecular Weight | 338.54 g/mol |
| Exact Mass | 338.30 |
| IUPAC Name | 5-butan-2-yl-N-ethyl-N-propylpyrazin-2-amine;ethane;morpholine |
| SMILES | C1COCCN1.CC.CCCN(CC)c1cnc(C(C)CC)cn1 |
| InChI | InChI=1S/C13H23N3.C4H9NO.C2H6/c1-5-8-16(7-3)13-10-14-12(9-15-13)11(4)6-2;1-3-6-4-2-5-1;1-2/h9-11H,5-8H2,1-4H3;5H,1-4H2;1-2H3 |
| InChIKey | FMZQACNKQDIWJP-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.54 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-butan-2-yl-N-ethyl-N-propylpyrazin-2-amine;ethane;morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-butan-2-yl-N-ethyl-N-propylpyrazin-2-amine;ethane;morpholine?
The IUPAC name of 5-butan-2-yl-N-ethyl-N-propylpyrazin-2-amine;ethane;morpholine (CID 144824938) is 5-butan-2-yl-N-ethyl-N-propylpyrazin-2-amine;ethane;morpholine.
What is the SMILES notation for 5-butan-2-yl-N-ethyl-N-propylpyrazin-2-amine;ethane;morpholine?
The canonical SMILES for 5-butan-2-yl-N-ethyl-N-propylpyrazin-2-amine;ethane;morpholine is C1COCCN1.CC.CCCN(CC)c1cnc(C(C)CC)cn1.
What is the InChIKey of 5-butan-2-yl-N-ethyl-N-propylpyrazin-2-amine;ethane;morpholine?
The InChIKey is FMZQACNKQDIWJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23N3.C4H9NO.C2H6/c1-5-8-16(7-3)13-10-14-12(9-15-13)11(4)6-2;1-3-6-4-2-5-1;1-2/h9-11H,5-8H2,1-4H3;5H,1-4H2;1-2H3.
What are the key properties of 5-butan-2-yl-N-ethyl-N-propylpyrazin-2-amine;ethane;morpholine?
5-butan-2-yl-N-ethyl-N-propylpyrazin-2-amine;ethane;morpholine has a molecular weight of 338.54 g/mol, XLogP of 3.86, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-butan-2-yl-N-ethyl-N-propylpyrazin-2-amine;ethane;morpholine is sourced from PubChem (CID 144824938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).