C7H13N5O — CID 144824965
5-amino-3-(propan-2-ylamino)-1H-pyrazole-4-carboxamide (PubChem CID 144824965) has the molecular formula C7H13N5O and a molecular weight of 183.22 g/mol. Its IUPAC name is 5-amino-3-(propan-2-ylamino)-1H-pyrazole-4-carboxamide.
| Compound Name | 5-amino-3-(propan-2-ylamino)-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 144824965 |
| Molecular Formula | C7H13N5O |
| Molecular Weight | 183.22 g/mol |
| Exact Mass | 183.11 |
| IUPAC Name | 5-amino-3-(propan-2-ylamino)-1H-pyrazole-4-carboxamide |
| SMILES | CC(C)Nc1n[nH]c(N)c1C(N)=O |
| InChI | InChI=1S/C7H13N5O/c1-3(2)10-7-4(6(9)13)5(8)11-12-7/h3H,1-2H3,(H2,9,13)(H4,8,10,11,12) |
| InChIKey | HYACMFBXJRWHAI-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 109.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.22 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |