C29H25NO2 — CID 144825176
(1S,8S)-10-[2-(7,8-dihydrophenanthren-9-yl)ethynyl]-14-oxa-7-azatetracyclo[6.6.1.01,11.02,7]pentadeca-9,11-dien-13-one (PubChem CID 144825176) has the molecular formula C29H25NO2 and a molecular weight of 419.52 g/mol. Its IUPAC name is (1S,8S)-10-[2-(7,8-dihydrophenanthren-9-yl)ethynyl]-14-oxa-7-azatetracyclo[6.6.1.01,11.02,7]pentadeca-9,11-dien-13-one.
| Compound Name | (1S,8S)-10-[2-(7,8-dihydrophenanthren-9-yl)ethynyl]-14-oxa-7-azatetracyclo[6.6.1.01,11.02,7]pentadeca-9,11-dien-13-one |
|---|---|
| PubChem CID | 144825176 |
| Molecular Formula | C29H25NO2 |
| Molecular Weight | 419.52 g/mol |
| Exact Mass | 419.19 |
| IUPAC Name | (1S,8S)-10-[2-(7,8-dihydrophenanthren-9-yl)ethynyl]-14-oxa-7-azatetracyclo[6.6.1.01,11.02,7]pentadeca-9,11-dien-13-one |
| SMILES | O=C1C=C2C(C#Cc3cc4ccccc4c4c3CCC=C4)=C[C@@H]3C[C@@]2(O1)C1CCCCN13 |
| InChI | InChI=1S/C29H25NO2/c31-28-17-26-21(16-22-18-29(26,32-28)27-11-5-6-14-30(22)27)13-12-20-15-19-7-1-2-8-23(19)25-10-4-3-9-24(20)25/h1-2,4,7-8,10,15-17,22,27H,3,5-6,9,11,14,18H2/t22-,27?,29+/m1/s1 |
| InChIKey | LMNPBTJKMDEHTO-GLXGGHELSA-N |
| XLogP | 4.94 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.52 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|