About methyl 2-aminodecanoate
methyl 2-aminodecanoate (PubChem CID 14482566) has the molecular formula C11H23NO2
and a molecular weight of 201.31 g/mol. Its IUPAC name is methyl 2-aminodecanoate.
Molecular Properties
| Compound Name | methyl 2-aminodecanoate |
| PubChem CID | 14482566 |
| Molecular Formula | C11H23NO2 |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.17 |
| IUPAC Name | methyl 2-aminodecanoate |
| SMILES | CCCCCCCCC(N)C(=O)OC |
| InChI | InChI=1S/C11H23NO2/c1-3-4-5-6-7-8-9-10(12)11(13)14-2/h10H,3-9,12H2,1-2H3 |
| InChIKey | MCUKSQZXVSZPAW-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-aminodecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-aminodecanoate?
The IUPAC name of methyl 2-aminodecanoate (CID 14482566) is methyl 2-aminodecanoate.
What is the SMILES notation for methyl 2-aminodecanoate?
The canonical SMILES for methyl 2-aminodecanoate is CCCCCCCCC(N)C(=O)OC.
What is the InChIKey of methyl 2-aminodecanoate?
The InChIKey is MCUKSQZXVSZPAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23NO2/c1-3-4-5-6-7-8-9-10(12)11(13)14-2/h10H,3-9,12H2,1-2H3.
What are the key properties of methyl 2-aminodecanoate?
methyl 2-aminodecanoate has a molecular weight of 201.31 g/mol, XLogP of 2.24, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-aminodecanoate is sourced from PubChem (CID 14482566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).