C40H59NO8 — CID 144825995
5-O-benzyl 1-O-[4-[4-[(3,3-dimethyl-4-oxo-4-phenylmethoxybutyl)iminomethoxy]-2-methylbutan-2-yl]oxy-2-methylbutan-2-yl] 2,2,4,4-tetramethylpentanedioate (PubChem CID 144825995) has the molecular formula C40H59NO8 and a molecular weight of 681.91 g/mol. Its IUPAC name is 5-O-benzyl 1-O-[4-[4-[(3,3-dimethyl-4-oxo-4-phenylmethoxybutyl)iminomethoxy]-2-methylbutan-2-yl]oxy-2-methylbutan-2-yl] 2,2,4,4-tetramethylpentanedioate.
| Compound Name | 5-O-benzyl 1-O-[4-[4-[(3,3-dimethyl-4-oxo-4-phenylmethoxybutyl)iminomethoxy]-2-methylbutan-2-yl]oxy-2-methylbutan-2-yl] 2,2,4,4-tetramethylpentanedioate |
|---|---|
| PubChem CID | 144825995 |
| Molecular Formula | C40H59NO8 |
| Molecular Weight | 681.91 g/mol |
| Exact Mass | 681.42 |
| IUPAC Name | 5-O-benzyl 1-O-[4-[4-[(3,3-dimethyl-4-oxo-4-phenylmethoxybutyl)iminomethoxy]-2-methylbutan-2-yl]oxy-2-methylbutan-2-yl] 2,2,4,4-tetramethylpentanedioate |
| SMILES | CC(C)(CCO/C=N/CCC(C)(C)C(=O)OCc1ccccc1)OCCC(C)(C)OC(=O)C(C)(C)CC(C)(C)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C40H59NO8/c1-36(2,33(42)46-27-31-17-13-11-14-18-31)21-24-41-30-45-25-22-39(7,8)48-26-23-40(9,10)49-35(44)38(5,6)29-37(3,4)34(43)47-28-32-19-15-12-16-20-32/h11-20,30H,21-29H2,1-10H3/b41-30+ |
| InChIKey | JPSBPMKMDOAKFJ-AETRBLLXSA-N |
| XLogP | 8.27 |
| TPSA | 109.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.91 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|