About 1-(4-fluorophenyl)sulfanyl-2,2-dimethylpyrrolidine;formic acid
1-(4-fluorophenyl)sulfanyl-2,2-dimethylpyrrolidine;formic acid (PubChem CID 144826164) has the molecular formula C13H18FNO2S
and a molecular weight of 271.36 g/mol. Its IUPAC name is 1-(4-fluorophenyl)sulfanyl-2,2-dimethylpyrrolidine;formic acid.
Molecular Properties
| Compound Name | 1-(4-fluorophenyl)sulfanyl-2,2-dimethylpyrrolidine;formic acid |
| PubChem CID | 144826164 |
| Molecular Formula | C13H18FNO2S |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | 1-(4-fluorophenyl)sulfanyl-2,2-dimethylpyrrolidine;formic acid |
| SMILES | CC1(C)CCCN1Sc1ccc(F)cc1.O=CO |
| InChI | InChI=1S/C12H16FNS.CH2O2/c1-12(2)8-3-9-14(12)15-11-6-4-10(13)5-7-11;2-1-3/h4-7H,3,8-9H2,1-2H3;1H,(H,2,3) |
| InChIKey | YTIHPGSYYYDMKY-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-fluorophenyl)sulfanyl-2,2-dimethylpyrrolidine;formic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-fluorophenyl)sulfanyl-2,2-dimethylpyrrolidine;formic acid?
The IUPAC name of 1-(4-fluorophenyl)sulfanyl-2,2-dimethylpyrrolidine;formic acid (CID 144826164) is 1-(4-fluorophenyl)sulfanyl-2,2-dimethylpyrrolidine;formic acid.
What is the SMILES notation for 1-(4-fluorophenyl)sulfanyl-2,2-dimethylpyrrolidine;formic acid?
The canonical SMILES for 1-(4-fluorophenyl)sulfanyl-2,2-dimethylpyrrolidine;formic acid is CC1(C)CCCN1Sc1ccc(F)cc1.O=CO.
What is the InChIKey of 1-(4-fluorophenyl)sulfanyl-2,2-dimethylpyrrolidine;formic acid?
The InChIKey is YTIHPGSYYYDMKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16FNS.CH2O2/c1-12(2)8-3-9-14(12)15-11-6-4-10(13)5-7-11;2-1-3/h4-7H,3,8-9H2,1-2H3;1H,(H,2,3).
What are the key properties of 1-(4-fluorophenyl)sulfanyl-2,2-dimethylpyrrolidine;formic acid?
1-(4-fluorophenyl)sulfanyl-2,2-dimethylpyrrolidine;formic acid has a molecular weight of 271.36 g/mol, XLogP of 3.41, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-fluorophenyl)sulfanyl-2,2-dimethylpyrrolidine;formic acid is sourced from PubChem (CID 144826164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).