C9H17N — CID 144826241
N-[(1Z)-2,3-dimethylbuta-1,3-dienyl]methanimine;ethane (PubChem CID 144826241) has the molecular formula C9H17N and a molecular weight of 139.24 g/mol. Its IUPAC name is N-[(1Z)-2,3-dimethylbuta-1,3-dienyl]methanimine;ethane.
| Compound Name | N-[(1Z)-2,3-dimethylbuta-1,3-dienyl]methanimine;ethane |
|---|---|
| PubChem CID | 144826241 |
| Molecular Formula | C9H17N |
| Molecular Weight | 139.24 g/mol |
| Exact Mass | 139.14 |
| IUPAC Name | N-[(1Z)-2,3-dimethylbuta-1,3-dienyl]methanimine;ethane |
| SMILES | C=N/C=C(/C)C(=C)C.CC |
| InChI | InChI=1S/C7H11N.C2H6/c1-6(2)7(3)5-8-4;1-2/h5H,1,4H2,2-3H3;1-2H3/b7-5-; |
| InChIKey | FEEPUBKNVFEZHY-YJOCEBFMSA-N |
| XLogP | 3.19 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.24 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|