C16H14F3N3O2 — CID 144826384
ethane;methyl 6-cyano-4-[6-(trifluoromethyl)-3-pyridinyl]pyridine-3-carboxylate (PubChem CID 144826384) has the molecular formula C16H14F3N3O2 and a molecular weight of 337.30 g/mol. Its IUPAC name is ethane;methyl 6-cyano-4-[6-(trifluoromethyl)-3-pyridinyl]pyridine-3-carboxylate.
| Compound Name | ethane;methyl 6-cyano-4-[6-(trifluoromethyl)-3-pyridinyl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 144826384 |
| Molecular Formula | C16H14F3N3O2 |
| Molecular Weight | 337.30 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | ethane;methyl 6-cyano-4-[6-(trifluoromethyl)-3-pyridinyl]pyridine-3-carboxylate |
| SMILES | CC.COC(=O)c1cnc(C#N)cc1-c1ccc(C(F)(F)F)nc1 |
| InChI | InChI=1S/C14H8F3N3O2.C2H6/c1-22-13(21)11-7-19-9(5-18)4-10(11)8-2-3-12(20-6-8)14(15,16)17;1-2/h2-4,6-7H,1H3;1-2H3 |
| InChIKey | XHPAGKDAJUQLQT-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 75.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.30 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |