C21H21F3N4O3 — CID 144826421
ethane;(2Z)-2-ethenyl-3-[[2-[2-(trifluoromethyl)pyrimidin-5-yl]-4-pyridinyl]methylcarbamoyl]penta-2,4-dienoic acid (PubChem CID 144826421) has the molecular formula C21H21F3N4O3 and a molecular weight of 434.42 g/mol. Its IUPAC name is ethane;(2Z)-2-ethenyl-3-[[2-[2-(trifluoromethyl)pyrimidin-5-yl]-4-pyridinyl]methylcarbamoyl]penta-2,4-dienoic acid.
| Compound Name | ethane;(2Z)-2-ethenyl-3-[[2-[2-(trifluoromethyl)pyrimidin-5-yl]-4-pyridinyl]methylcarbamoyl]penta-2,4-dienoic acid |
|---|---|
| PubChem CID | 144826421 |
| Molecular Formula | C21H21F3N4O3 |
| Molecular Weight | 434.42 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | ethane;(2Z)-2-ethenyl-3-[[2-[2-(trifluoromethyl)pyrimidin-5-yl]-4-pyridinyl]methylcarbamoyl]penta-2,4-dienoic acid |
| SMILES | C=C/C(C(=O)O)=C(\C=C)C(=O)NCc1ccnc(-c2cnc(C(F)(F)F)nc2)c1.CC |
| InChI | InChI=1S/C19H15F3N4O3.C2H6/c1-3-13(14(4-2)17(28)29)16(27)24-8-11-5-6-23-15(7-11)12-9-25-18(26-10-12)19(20,21)22;1-2/h3-7,9-10H,1-2,8H2,(H,24,27)(H,28,29);1-2H3/b14-13-; |
| InChIKey | FQXBZWWEAOTYJV-HPWRNOGASA-N |
| XLogP | 3.95 |
| TPSA | 105.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.42 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|