C14H16F3N3S — CID 144826439
ethane;[6-[4-(trifluoromethylsulfanyl)phenyl]pyrimidin-4-yl]methanamine (PubChem CID 144826439) has the molecular formula C14H16F3N3S and a molecular weight of 315.36 g/mol. Its IUPAC name is ethane;[6-[4-(trifluoromethylsulfanyl)phenyl]pyrimidin-4-yl]methanamine.
| Compound Name | ethane;[6-[4-(trifluoromethylsulfanyl)phenyl]pyrimidin-4-yl]methanamine |
|---|---|
| PubChem CID | 144826439 |
| Molecular Formula | C14H16F3N3S |
| Molecular Weight | 315.36 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | ethane;[6-[4-(trifluoromethylsulfanyl)phenyl]pyrimidin-4-yl]methanamine |
| SMILES | CC.NCc1cc(-c2ccc(SC(F)(F)F)cc2)ncn1 |
| InChI | InChI=1S/C12H10F3N3S.C2H6/c13-12(14,15)19-10-3-1-8(2-4-10)11-5-9(6-16)17-7-18-11;1-2/h1-5,7H,6,16H2;1-2H3 |
| InChIKey | JPGCJDYUEZONJK-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.36 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |