C21H16ClF3N4O2 — CID 144826488
2-[[5-chloro-4-[2-(trifluoromethyl)pyrimidin-5-yl]-2-pyridinyl]methyl]isoindole-1,3-dione;ethane (PubChem CID 144826488) has the molecular formula C21H16ClF3N4O2 and a molecular weight of 448.83 g/mol. Its IUPAC name is 2-[[5-chloro-4-[2-(trifluoromethyl)pyrimidin-5-yl]-2-pyridinyl]methyl]isoindole-1,3-dione;ethane.
| Compound Name | 2-[[5-chloro-4-[2-(trifluoromethyl)pyrimidin-5-yl]-2-pyridinyl]methyl]isoindole-1,3-dione;ethane |
|---|---|
| PubChem CID | 144826488 |
| Molecular Formula | C21H16ClF3N4O2 |
| Molecular Weight | 448.83 g/mol |
| Exact Mass | 448.09 |
| IUPAC Name | 2-[[5-chloro-4-[2-(trifluoromethyl)pyrimidin-5-yl]-2-pyridinyl]methyl]isoindole-1,3-dione;ethane |
| SMILES | CC.O=C1c2ccccc2C(=O)N1Cc1cc(-c2cnc(C(F)(F)F)nc2)c(Cl)cn1 |
| InChI | InChI=1S/C19H10ClF3N4O2.C2H6/c20-15-8-24-11(5-14(15)10-6-25-18(26-7-10)19(21,22)23)9-27-16(28)12-3-1-2-4-13(12)17(27)29;1-2/h1-8H,9H2;1-2H3 |
| InChIKey | YYUACFAYDZXAKC-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 76.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.83 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|