C16H17FN4O2S — CID 144826659
1-(4-fluorophenyl)sulfinyl-N-(pyrimidin-4-ylmethyl)pyrrolidine-2-carboxamide (PubChem CID 144826659) has the molecular formula C16H17FN4O2S and a molecular weight of 348.40 g/mol. Its IUPAC name is 1-(4-fluorophenyl)sulfinyl-N-(pyrimidin-4-ylmethyl)pyrrolidine-2-carboxamide.
| Compound Name | 1-(4-fluorophenyl)sulfinyl-N-(pyrimidin-4-ylmethyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 144826659 |
| Molecular Formula | C16H17FN4O2S |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | 1-(4-fluorophenyl)sulfinyl-N-(pyrimidin-4-ylmethyl)pyrrolidine-2-carboxamide |
| SMILES | O=C(NCc1ccncn1)C1CCCN1S(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C16H17FN4O2S/c17-12-3-5-14(6-4-12)24(23)21-9-1-2-15(21)16(22)19-10-13-7-8-18-11-20-13/h3-8,11,15H,1-2,9-10H2,(H,19,22) |
| InChIKey | KXGRDIVUGMLSSK-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |