C27H42FNO — CID 144826843
4-[(2E,4E,6Z)-4-[[[1-[(2Z,4Z)-2-fluorohexa-2,4-dien-3-yl]cyclopentyl]amino]methyl]-2-methylocta-2,4,6-trienyl]cyclohexan-1-ol (PubChem CID 144826843) has the molecular formula C27H42FNO and a molecular weight of 415.64 g/mol. Its IUPAC name is 4-[(2E,4E,6Z)-4-[[[1-[(2Z,4Z)-2-fluorohexa-2,4-dien-3-yl]cyclopentyl]amino]methyl]-2-methylocta-2,4,6-trienyl]cyclohexan-1-ol.
| Compound Name | 4-[(2E,4E,6Z)-4-[[[1-[(2Z,4Z)-2-fluorohexa-2,4-dien-3-yl]cyclopentyl]amino]methyl]-2-methylocta-2,4,6-trienyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 144826843 |
| Molecular Formula | C27H42FNO |
| Molecular Weight | 415.64 g/mol |
| Exact Mass | 415.33 |
| IUPAC Name | 4-[(2E,4E,6Z)-4-[[[1-[(2Z,4Z)-2-fluorohexa-2,4-dien-3-yl]cyclopentyl]amino]methyl]-2-methylocta-2,4,6-trienyl]cyclohexan-1-ol |
| SMILES | C/C=C\C=C(/C=C(\C)CC1CCC(O)CC1)CNC1(C(/C=C\C)=C(/C)F)CCCC1 |
| InChI | InChI=1S/C27H42FNO/c1-5-7-11-24(19-21(3)18-23-12-14-25(30)15-13-23)20-29-27(16-8-9-17-27)26(10-6-2)22(4)28/h5-7,10-11,19,23,25,29-30H,8-9,12-18,20H2,1-4H3/b7-5-,10-6-,21-19+,24-11+,26-22- |
| InChIKey | AIOBDMNJMNAZIP-CRULGRTMSA-N |
| XLogP | 7.10 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.64 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|