C25H36FN3O2 — CID 144826860
4-[(2Z,4Z)-2-fluorohexa-2,4-dien-3-yl]-4-[[4-hydroxy-3-[(4-methylpiperazin-1-yl)methyl]phenyl]methylamino]cyclohexan-1-one (PubChem CID 144826860) has the molecular formula C25H36FN3O2 and a molecular weight of 429.58 g/mol. Its IUPAC name is 4-[(2Z,4Z)-2-fluorohexa-2,4-dien-3-yl]-4-[[4-hydroxy-3-[(4-methylpiperazin-1-yl)methyl]phenyl]methylamino]cyclohexan-1-one.
| Compound Name | 4-[(2Z,4Z)-2-fluorohexa-2,4-dien-3-yl]-4-[[4-hydroxy-3-[(4-methylpiperazin-1-yl)methyl]phenyl]methylamino]cyclohexan-1-one |
|---|---|
| PubChem CID | 144826860 |
| Molecular Formula | C25H36FN3O2 |
| Molecular Weight | 429.58 g/mol |
| Exact Mass | 429.28 |
| IUPAC Name | 4-[(2Z,4Z)-2-fluorohexa-2,4-dien-3-yl]-4-[[4-hydroxy-3-[(4-methylpiperazin-1-yl)methyl]phenyl]methylamino]cyclohexan-1-one |
| SMILES | C/C=C\C(=C(/C)F)C1(NCc2ccc(O)c(CN3CCN(C)CC3)c2)CCC(=O)CC1 |
| InChI | InChI=1S/C25H36FN3O2/c1-4-5-23(19(2)26)25(10-8-22(30)9-11-25)27-17-20-6-7-24(31)21(16-20)18-29-14-12-28(3)13-15-29/h4-7,16,27,31H,8-15,17-18H2,1-3H3/b5-4-,23-19- |
| InChIKey | JQMHLMXVUYMHDQ-AIOFJAQPSA-N |
| XLogP | 3.93 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.58 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|