About N-[2-(phosphanylamino)propoxy]formamide;6-phosphanyl-1,6-diazabicyclo[3.2.1]octan-7-one
N-[2-(phosphanylamino)propoxy]formamide;6-phosphanyl-1,6-diazabicyclo[3.2.1]octan-7-one (PubChem CID 144827224) has the molecular formula C10H22N4O3P2
and a molecular weight of 308.26 g/mol. Its IUPAC name is N-[2-(phosphanylamino)propoxy]formamide;6-phosphanyl-1,6-diazabicyclo[3.2.1]octan-7-one.
Molecular Properties
| Compound Name | N-[2-(phosphanylamino)propoxy]formamide;6-phosphanyl-1,6-diazabicyclo[3.2.1]octan-7-one |
| PubChem CID | 144827224 |
| Molecular Formula | C10H22N4O3P2 |
| Molecular Weight | 308.26 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | N-[2-(phosphanylamino)propoxy]formamide;6-phosphanyl-1,6-diazabicyclo[3.2.1]octan-7-one |
| SMILES | CC(CONC=O)NP.O=C1N2CCCC(C2)N1P |
| InChI | InChI=1S/C6H11N2OP.C4H11N2O2P/c9-6-7-3-1-2-5(4-7)8(6)10;1-4(6-9)2-8-5-3-7/h5H,1-4,10H2;3-4,6H,2,9H2,1H3,(H,5,7) |
| InChIKey | PELMUCQVZBDYGI-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.26 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(phosphanylamino)propoxy]formamide;6-phosphanyl-1,6-diazabicyclo[3.2.1]octan-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(phosphanylamino)propoxy]formamide;6-phosphanyl-1,6-diazabicyclo[3.2.1]octan-7-one?
The IUPAC name of N-[2-(phosphanylamino)propoxy]formamide;6-phosphanyl-1,6-diazabicyclo[3.2.1]octan-7-one (CID 144827224) is N-[2-(phosphanylamino)propoxy]formamide;6-phosphanyl-1,6-diazabicyclo[3.2.1]octan-7-one.
What is the SMILES notation for N-[2-(phosphanylamino)propoxy]formamide;6-phosphanyl-1,6-diazabicyclo[3.2.1]octan-7-one?
The canonical SMILES for N-[2-(phosphanylamino)propoxy]formamide;6-phosphanyl-1,6-diazabicyclo[3.2.1]octan-7-one is CC(CONC=O)NP.O=C1N2CCCC(C2)N1P.
What is the InChIKey of N-[2-(phosphanylamino)propoxy]formamide;6-phosphanyl-1,6-diazabicyclo[3.2.1]octan-7-one?
The InChIKey is PELMUCQVZBDYGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11N2OP.C4H11N2O2P/c9-6-7-3-1-2-5(4-7)8(6)10;1-4(6-9)2-8-5-3-7/h5H,1-4,10H2;3-4,6H,2,9H2,1H3,(H,5,7).
What are the key properties of N-[2-(phosphanylamino)propoxy]formamide;6-phosphanyl-1,6-diazabicyclo[3.2.1]octan-7-one?
N-[2-(phosphanylamino)propoxy]formamide;6-phosphanyl-1,6-diazabicyclo[3.2.1]octan-7-one has a molecular weight of 308.26 g/mol, XLogP of 0.11, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(phosphanylamino)propoxy]formamide;6-phosphanyl-1,6-diazabicyclo[3.2.1]octan-7-one is sourced from PubChem (CID 144827224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).