About N-(azetidin-2-ylmethoxy)formamide;6-phosphanyl-1,6-diazabicyclo[3.2.1]octan-7-one
N-(azetidin-2-ylmethoxy)formamide;6-phosphanyl-1,6-diazabicyclo[3.2.1]octan-7-one (PubChem CID 144827228) has the molecular formula C11H21N4O3P
and a molecular weight of 288.29 g/mol. Its IUPAC name is N-(azetidin-2-ylmethoxy)formamide;6-phosphanyl-1,6-diazabicyclo[3.2.1]octan-7-one.
Molecular Properties
| Compound Name | N-(azetidin-2-ylmethoxy)formamide;6-phosphanyl-1,6-diazabicyclo[3.2.1]octan-7-one |
| PubChem CID | 144827228 |
| Molecular Formula | C11H21N4O3P |
| Molecular Weight | 288.29 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | N-(azetidin-2-ylmethoxy)formamide;6-phosphanyl-1,6-diazabicyclo[3.2.1]octan-7-one |
| SMILES | O=C1N2CCCC(C2)N1P.O=CNOCC1CCN1 |
| InChI | InChI=1S/C6H11N2OP.C5H10N2O2/c9-6-7-3-1-2-5(4-7)8(6)10;8-4-7-9-3-5-1-2-6-5/h5H,1-4,10H2;4-6H,1-3H2,(H,7,8) |
| InChIKey | QGNMVAQGGMCWCK-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.29 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze N-(azetidin-2-ylmethoxy)formamide;6-phosphanyl-1,6-diazabicyclo[3.2.1]octan-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(azetidin-2-ylmethoxy)formamide;6-phosphanyl-1,6-diazabicyclo[3.2.1]octan-7-one?
The IUPAC name of N-(azetidin-2-ylmethoxy)formamide;6-phosphanyl-1,6-diazabicyclo[3.2.1]octan-7-one (CID 144827228) is N-(azetidin-2-ylmethoxy)formamide;6-phosphanyl-1,6-diazabicyclo[3.2.1]octan-7-one.
What is the SMILES notation for N-(azetidin-2-ylmethoxy)formamide;6-phosphanyl-1,6-diazabicyclo[3.2.1]octan-7-one?
The canonical SMILES for N-(azetidin-2-ylmethoxy)formamide;6-phosphanyl-1,6-diazabicyclo[3.2.1]octan-7-one is O=C1N2CCCC(C2)N1P.O=CNOCC1CCN1.
What is the InChIKey of N-(azetidin-2-ylmethoxy)formamide;6-phosphanyl-1,6-diazabicyclo[3.2.1]octan-7-one?
The InChIKey is QGNMVAQGGMCWCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11N2OP.C5H10N2O2/c9-6-7-3-1-2-5(4-7)8(6)10;8-4-7-9-3-5-1-2-6-5/h5H,1-4,10H2;4-6H,1-3H2,(H,7,8).
What are the key properties of N-(azetidin-2-ylmethoxy)formamide;6-phosphanyl-1,6-diazabicyclo[3.2.1]octan-7-one?
N-(azetidin-2-ylmethoxy)formamide;6-phosphanyl-1,6-diazabicyclo[3.2.1]octan-7-one has a molecular weight of 288.29 g/mol, XLogP of -0.30, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(azetidin-2-ylmethoxy)formamide;6-phosphanyl-1,6-diazabicyclo[3.2.1]octan-7-one is sourced from PubChem (CID 144827228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).