About 6-phosphanyl-1,6-diazabicyclo[3.2.1]octan-7-one;N-(piperidin-3-ylmethoxy)formamide
6-phosphanyl-1,6-diazabicyclo[3.2.1]octan-7-one;N-(piperidin-3-ylmethoxy)formamide (PubChem CID 144827233) has the molecular formula C13H25N4O3P
and a molecular weight of 316.34 g/mol. Its IUPAC name is 6-phosphanyl-1,6-diazabicyclo[3.2.1]octan-7-one;N-(piperidin-3-ylmethoxy)formamide.
Molecular Properties
| Compound Name | 6-phosphanyl-1,6-diazabicyclo[3.2.1]octan-7-one;N-(piperidin-3-ylmethoxy)formamide |
| PubChem CID | 144827233 |
| Molecular Formula | C13H25N4O3P |
| Molecular Weight | 316.34 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | 6-phosphanyl-1,6-diazabicyclo[3.2.1]octan-7-one;N-(piperidin-3-ylmethoxy)formamide |
| SMILES | O=C1N2CCCC(C2)N1P.O=CNOCC1CCCNC1 |
| InChI | InChI=1S/C7H14N2O2.C6H11N2OP/c10-6-9-11-5-7-2-1-3-8-4-7;9-6-7-3-1-2-5(4-7)8(6)10/h6-8H,1-5H2,(H,9,10);5H,1-4,10H2 |
| InChIKey | NHZXJYLYFDOKOT-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.34 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 6-phosphanyl-1,6-diazabicyclo[3.2.1]octan-7-one;N-(piperidin-3-ylmethoxy)formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-phosphanyl-1,6-diazabicyclo[3.2.1]octan-7-one;N-(piperidin-3-ylmethoxy)formamide?
The IUPAC name of 6-phosphanyl-1,6-diazabicyclo[3.2.1]octan-7-one;N-(piperidin-3-ylmethoxy)formamide (CID 144827233) is 6-phosphanyl-1,6-diazabicyclo[3.2.1]octan-7-one;N-(piperidin-3-ylmethoxy)formamide.
What is the SMILES notation for 6-phosphanyl-1,6-diazabicyclo[3.2.1]octan-7-one;N-(piperidin-3-ylmethoxy)formamide?
The canonical SMILES for 6-phosphanyl-1,6-diazabicyclo[3.2.1]octan-7-one;N-(piperidin-3-ylmethoxy)formamide is O=C1N2CCCC(C2)N1P.O=CNOCC1CCCNC1.
What is the InChIKey of 6-phosphanyl-1,6-diazabicyclo[3.2.1]octan-7-one;N-(piperidin-3-ylmethoxy)formamide?
The InChIKey is NHZXJYLYFDOKOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N2O2.C6H11N2OP/c10-6-9-11-5-7-2-1-3-8-4-7;9-6-7-3-1-2-5(4-7)8(6)10/h6-8H,1-5H2,(H,9,10);5H,1-4,10H2.
What are the key properties of 6-phosphanyl-1,6-diazabicyclo[3.2.1]octan-7-one;N-(piperidin-3-ylmethoxy)formamide?
6-phosphanyl-1,6-diazabicyclo[3.2.1]octan-7-one;N-(piperidin-3-ylmethoxy)formamide has a molecular weight of 316.34 g/mol, XLogP of 0.34, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-phosphanyl-1,6-diazabicyclo[3.2.1]octan-7-one;N-(piperidin-3-ylmethoxy)formamide is sourced from PubChem (CID 144827233), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).