C16H21N — CID 144827686
(9,9-dimethyl-3,4,5,6-tetrahydrofluoren-1-yl)methanamine (PubChem CID 144827686) has the molecular formula C16H21N and a molecular weight of 227.35 g/mol. Its IUPAC name is (9,9-dimethyl-3,4,5,6-tetrahydrofluoren-1-yl)methanamine.
| Compound Name | (9,9-dimethyl-3,4,5,6-tetrahydrofluoren-1-yl)methanamine |
|---|---|
| PubChem CID | 144827686 |
| Molecular Formula | C16H21N |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.17 |
| IUPAC Name | (9,9-dimethyl-3,4,5,6-tetrahydrofluoren-1-yl)methanamine |
| SMILES | CC1(C)C2=C(CCC=C2)C2=C1C(CN)=CCC2 |
| InChI | InChI=1S/C16H21N/c1-16(2)14-9-4-3-7-12(14)13-8-5-6-11(10-17)15(13)16/h4,6,9H,3,5,7-8,10,17H2,1-2H3 |
| InChIKey | LIYINVIIRPLWOB-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |