C24H26F6N2O7S2 — CID 144828064
4,8-bis[[3-(trifluoromethoxy)phenyl]sulfonyl]-1-oxa-4,8-diazaspiro[4.5]decane;prop-1-ene (PubChem CID 144828064) has the molecular formula C24H26F6N2O7S2 and a molecular weight of 632.60 g/mol. Its IUPAC name is 4,8-bis[[3-(trifluoromethoxy)phenyl]sulfonyl]-1-oxa-4,8-diazaspiro[4.5]decane;prop-1-ene.
| Compound Name | 4,8-bis[[3-(trifluoromethoxy)phenyl]sulfonyl]-1-oxa-4,8-diazaspiro[4.5]decane;prop-1-ene |
|---|---|
| PubChem CID | 144828064 |
| Molecular Formula | C24H26F6N2O7S2 |
| Molecular Weight | 632.60 g/mol |
| Exact Mass | 632.11 |
| IUPAC Name | 4,8-bis[[3-(trifluoromethoxy)phenyl]sulfonyl]-1-oxa-4,8-diazaspiro[4.5]decane;prop-1-ene |
| SMILES | C=CC.O=S(=O)(c1cccc(OC(F)(F)F)c1)N1CCC2(CC1)OCCN2S(=O)(=O)c1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C21H20F6N2O7S2.C3H6/c22-20(23,24)35-15-3-1-5-17(13-15)37(30,31)28-9-7-19(8-10-28)29(11-12-34-19)38(32,33)18-6-2-4-16(14-18)36-21(25,26)27;1-3-2/h1-6,13-14H,7-12H2;3H,1H2,2H3 |
| InChIKey | HYRPGDIIPJTEEI-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 102.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.60 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|