C32H38F3N5OS — CID 144828096
cis-(2R,5S)-2-[2-[(1Z,3Z)-1,4-diaminopenta-1,3-dienyl]-5-[4-(4,4-difluoropiperidin-1-yl)phenyl]-1,3-thiazol-4-yl]-5-fluoro-N-(1-prop-1-ynylcyclopropyl)cyclohexane-1-carboxamide (PubChem CID 144828096) has the molecular formula C32H38F3N5OS and a molecular weight of 597.75 g/mol. Its IUPAC name is cis-(2R,5S)-2-[2-[(1Z,3Z)-1,4-diaminopenta-1,3-dienyl]-5-[4-(4,4-difluoropiperidin-1-yl)phenyl]-1,3-thiazol-4-yl]-5-fluoro-N-(1-prop-1-ynylcyclopropyl)cyclohexane-1-carboxamide.
| Compound Name | cis-(2R,5S)-2-[2-[(1Z,3Z)-1,4-diaminopenta-1,3-dienyl]-5-[4-(4,4-difluoropiperidin-1-yl)phenyl]-1,3-thiazol-4-yl]-5-fluoro-N-(1-prop-1-ynylcyclopropyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 144828096 |
| Molecular Formula | C32H38F3N5OS |
| Molecular Weight | 597.75 g/mol |
| Exact Mass | 597.27 |
| IUPAC Name | cis-(2R,5S)-2-[2-[(1Z,3Z)-1,4-diaminopenta-1,3-dienyl]-5-[4-(4,4-difluoropiperidin-1-yl)phenyl]-1,3-thiazol-4-yl]-5-fluoro-N-(1-prop-1-ynylcyclopropyl)cyclohexane-1-carboxamide |
| SMILES | CC#CC1(NC(=O)C2C[C@@H](F)CC[C@H]2c2nc(/C(N)=C/C=C(/C)N)sc2-c2ccc(N3CCC(F)(F)CC3)cc2)CC1 |
| InChI | InChI=1S/C32H38F3N5OS/c1-3-12-31(13-14-31)39-29(41)25-19-22(33)7-10-24(25)27-28(42-30(38-27)26(37)11-4-20(2)36)21-5-8-23(9-6-21)40-17-15-32(34,35)16-18-40/h4-6,8-9,11,22,24-25H,7,10,13-19,36-37H2,1-2H3,(H,39,41)/b20-4-,26-11-/t22-,24+,25?/m0/s1 |
| InChIKey | BXBXKJDOGXJOOF-XNZBDERASA-N |
| XLogP | 6.10 |
| TPSA | 97.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.75 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|