C21H25BrF5NO3 — CID 144828346
4-(4-bromophenyl)-2-(1,1,2,2,2-pentafluoroethyl)-1,3-oxazole;ethane;methyl cyclohexanecarboxylate (PubChem CID 144828346) has the molecular formula C21H25BrF5NO3 and a molecular weight of 514.33 g/mol. Its IUPAC name is 4-(4-bromophenyl)-2-(1,1,2,2,2-pentafluoroethyl)-1,3-oxazole;ethane;methyl cyclohexanecarboxylate.
| Compound Name | 4-(4-bromophenyl)-2-(1,1,2,2,2-pentafluoroethyl)-1,3-oxazole;ethane;methyl cyclohexanecarboxylate |
|---|---|
| PubChem CID | 144828346 |
| Molecular Formula | C21H25BrF5NO3 |
| Molecular Weight | 514.33 g/mol |
| Exact Mass | 513.09 |
| IUPAC Name | 4-(4-bromophenyl)-2-(1,1,2,2,2-pentafluoroethyl)-1,3-oxazole;ethane;methyl cyclohexanecarboxylate |
| SMILES | CC.COC(=O)C1CCCCC1.FC(F)(F)C(F)(F)c1nc(-c2ccc(Br)cc2)co1 |
| InChI | InChI=1S/C11H5BrF5NO.C8H14O2.C2H6/c12-7-3-1-6(2-4-7)8-5-19-9(18-8)10(13,14)11(15,16)17;1-10-8(9)7-5-3-2-4-6-7;1-2/h1-5H;7H,2-6H2,1H3;1-2H3 |
| InChIKey | YASKZRLIQCNUBG-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.33 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|