About 4-cyclohexylpyridine;1H-indazole
4-cyclohexylpyridine;1H-indazole (PubChem CID 144828632) has the molecular formula C18H21N3
and a molecular weight of 279.39 g/mol. Its IUPAC name is 4-cyclohexylpyridine;1H-indazole.
Molecular Properties
| Compound Name | 4-cyclohexylpyridine;1H-indazole |
| PubChem CID | 144828632 |
| Molecular Formula | C18H21N3 |
| Molecular Weight | 279.39 g/mol |
| Exact Mass | 279.17 |
| IUPAC Name | 4-cyclohexylpyridine;1H-indazole |
| SMILES | c1cc(C2CCCCC2)ccn1.c1ccc2[nH]ncc2c1 |
| InChI | InChI=1S/C11H15N.C7H6N2/c1-2-4-10(5-3-1)11-6-8-12-9-7-11;1-2-4-7-6(3-1)5-8-9-7/h6-10H,1-5H2;1-5H,(H,8,9) |
| InChIKey | OFBNTVBJPGIHNT-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.39 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-cyclohexylpyridine;1H-indazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclohexylpyridine;1H-indazole?
The IUPAC name of 4-cyclohexylpyridine;1H-indazole (CID 144828632) is 4-cyclohexylpyridine;1H-indazole.
What is the SMILES notation for 4-cyclohexylpyridine;1H-indazole?
The canonical SMILES for 4-cyclohexylpyridine;1H-indazole is c1cc(C2CCCCC2)ccn1.c1ccc2[nH]ncc2c1.
What is the InChIKey of 4-cyclohexylpyridine;1H-indazole?
The InChIKey is OFBNTVBJPGIHNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N.C7H6N2/c1-2-4-10(5-3-1)11-6-8-12-9-7-11;1-2-4-7-6(3-1)5-8-9-7/h6-10H,1-5H2;1-5H,(H,8,9).
What are the key properties of 4-cyclohexylpyridine;1H-indazole?
4-cyclohexylpyridine;1H-indazole has a molecular weight of 279.39 g/mol, XLogP of 4.69, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclohexylpyridine;1H-indazole is sourced from PubChem (CID 144828632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).