C24H25ClN4O2 — CID 144828646
2-(N-(2-chlorophenyl)anilino)-N-(7-oxoheptyl)pyrimidine-5-carboxamide (PubChem CID 144828646) has the molecular formula C24H25ClN4O2 and a molecular weight of 436.94 g/mol. Its IUPAC name is 2-(N-(2-chlorophenyl)anilino)-N-(7-oxoheptyl)pyrimidine-5-carboxamide.
| Compound Name | 2-(N-(2-chlorophenyl)anilino)-N-(7-oxoheptyl)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 144828646 |
| Molecular Formula | C24H25ClN4O2 |
| Molecular Weight | 436.94 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | 2-(N-(2-chlorophenyl)anilino)-N-(7-oxoheptyl)pyrimidine-5-carboxamide |
| SMILES | O=CCCCCCCNC(=O)c1cnc(N(c2ccccc2)c2ccccc2Cl)nc1 |
| InChI | InChI=1S/C24H25ClN4O2/c25-21-13-7-8-14-22(21)29(20-11-5-4-6-12-20)24-27-17-19(18-28-24)23(31)26-15-9-2-1-3-10-16-30/h4-8,11-14,16-18H,1-3,9-10,15H2,(H,26,31) |
| InChIKey | HYOBHBJTOQBVJP-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.94 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|