C20H28N2O3 — CID 144829094
2-cyclopropyl-1-(2-morpholin-4-ylethyl)indole-5-carboxylic acid;ethane (PubChem CID 144829094) has the molecular formula C20H28N2O3 and a molecular weight of 344.46 g/mol. Its IUPAC name is 2-cyclopropyl-1-(2-morpholin-4-ylethyl)indole-5-carboxylic acid;ethane.
| Compound Name | 2-cyclopropyl-1-(2-morpholin-4-ylethyl)indole-5-carboxylic acid;ethane |
|---|---|
| PubChem CID | 144829094 |
| Molecular Formula | C20H28N2O3 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.21 |
| IUPAC Name | 2-cyclopropyl-1-(2-morpholin-4-ylethyl)indole-5-carboxylic acid;ethane |
| SMILES | CC.O=C(O)c1ccc2c(c1)cc(C1CC1)n2CCN1CCOCC1 |
| InChI | InChI=1S/C18H22N2O3.C2H6/c21-18(22)14-3-4-16-15(11-14)12-17(13-1-2-13)20(16)6-5-19-7-9-23-10-8-19;1-2/h3-4,11-13H,1-2,5-10H2,(H,21,22);1-2H3 |
| InChIKey | KTDBVKMELHTYNY-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |