C7H11FN2O — CID 144829273
1-[(1Z)-1-fluoro-3-methylbuta-1,3-dien-2-yl]-3-methylurea (PubChem CID 144829273) has the molecular formula C7H11FN2O and a molecular weight of 158.18 g/mol. Its IUPAC name is 1-[(1Z)-1-fluoro-3-methylbuta-1,3-dien-2-yl]-3-methylurea.
| Compound Name | 1-[(1Z)-1-fluoro-3-methylbuta-1,3-dien-2-yl]-3-methylurea |
|---|---|
| PubChem CID | 144829273 |
| Molecular Formula | C7H11FN2O |
| Molecular Weight | 158.18 g/mol |
| Exact Mass | 158.09 |
| IUPAC Name | 1-[(1Z)-1-fluoro-3-methylbuta-1,3-dien-2-yl]-3-methylurea |
| SMILES | C=C(C)/C(=C/F)NC(=O)NC |
| InChI | InChI=1S/C7H11FN2O/c1-5(2)6(4-8)10-7(11)9-3/h4H,1H2,2-3H3,(H2,9,10,11)/b6-4- |
| InChIKey | HMTICPANNYVDOS-XQRVVYSFSA-N |
| XLogP | 1.30 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.18 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|