C19H23N3O2 — CID 144830280
2-cyclohexyloxy-6-[(3E)-hexa-1,3,5-trien-3-yl]oxy-1-methylimidazo[4,5-c]pyridine (PubChem CID 144830280) has the molecular formula C19H23N3O2 and a molecular weight of 325.41 g/mol. Its IUPAC name is 2-cyclohexyloxy-6-[(3E)-hexa-1,3,5-trien-3-yl]oxy-1-methylimidazo[4,5-c]pyridine.
| Compound Name | 2-cyclohexyloxy-6-[(3E)-hexa-1,3,5-trien-3-yl]oxy-1-methylimidazo[4,5-c]pyridine |
|---|---|
| PubChem CID | 144830280 |
| Molecular Formula | C19H23N3O2 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | 2-cyclohexyloxy-6-[(3E)-hexa-1,3,5-trien-3-yl]oxy-1-methylimidazo[4,5-c]pyridine |
| SMILES | C=C/C=C(\C=C)Oc1cc2c(cn1)nc(OC1CCCCC1)n2C |
| InChI | InChI=1S/C19H23N3O2/c1-4-9-14(5-2)23-18-12-17-16(13-20-18)21-19(22(17)3)24-15-10-7-6-8-11-15/h4-5,9,12-13,15H,1-2,6-8,10-11H2,3H3/b14-9+ |
| InChIKey | HNDVQHAYPJXRQV-NTEUORMPSA-N |
| XLogP | 4.31 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|