About ethene;(2E)-N-ethyl-2-(1-methoxyethenyl)-4-methylpenta-2,4-dienamide
ethene;(2E)-N-ethyl-2-(1-methoxyethenyl)-4-methylpenta-2,4-dienamide (PubChem CID 144830314) has the molecular formula C13H21NO2
and a molecular weight of 223.32 g/mol. Its IUPAC name is ethene;(2E)-N-ethyl-2-(1-methoxyethenyl)-4-methylpenta-2,4-dienamide.
Molecular Properties
| Compound Name | ethene;(2E)-N-ethyl-2-(1-methoxyethenyl)-4-methylpenta-2,4-dienamide |
| PubChem CID | 144830314 |
| Molecular Formula | C13H21NO2 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.16 |
| IUPAC Name | ethene;(2E)-N-ethyl-2-(1-methoxyethenyl)-4-methylpenta-2,4-dienamide |
| SMILES | C=C.C=C(C)/C=C(\C(=C)OC)C(=O)NCC |
| InChI | InChI=1S/C11H17NO2.C2H4/c1-6-12-11(13)10(7-8(2)3)9(4)14-5;1-2/h7H,2,4,6H2,1,3,5H3,(H,12,13);1-2H2/b10-7+; |
| InChIKey | NVORQTQGLGJBII-HCUGZAAXSA-N |
| XLogP | 2.59 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethene;(2E)-N-ethyl-2-(1-methoxyethenyl)-4-methylpenta-2,4-dienamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethene;(2E)-N-ethyl-2-(1-methoxyethenyl)-4-methylpenta-2,4-dienamide?
The IUPAC name of ethene;(2E)-N-ethyl-2-(1-methoxyethenyl)-4-methylpenta-2,4-dienamide (CID 144830314) is ethene;(2E)-N-ethyl-2-(1-methoxyethenyl)-4-methylpenta-2,4-dienamide.
What is the SMILES notation for ethene;(2E)-N-ethyl-2-(1-methoxyethenyl)-4-methylpenta-2,4-dienamide?
The canonical SMILES for ethene;(2E)-N-ethyl-2-(1-methoxyethenyl)-4-methylpenta-2,4-dienamide is C=C.C=C(C)/C=C(\C(=C)OC)C(=O)NCC.
What is the InChIKey of ethene;(2E)-N-ethyl-2-(1-methoxyethenyl)-4-methylpenta-2,4-dienamide?
The InChIKey is NVORQTQGLGJBII-HCUGZAAXSA-N. The full InChI is InChI=1S/C11H17NO2.C2H4/c1-6-12-11(13)10(7-8(2)3)9(4)14-5;1-2/h7H,2,4,6H2,1,3,5H3,(H,12,13);1-2H2/b10-7+;.
What are the key properties of ethene;(2E)-N-ethyl-2-(1-methoxyethenyl)-4-methylpenta-2,4-dienamide?
ethene;(2E)-N-ethyl-2-(1-methoxyethenyl)-4-methylpenta-2,4-dienamide has a molecular weight of 223.32 g/mol, XLogP of 2.59, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethene;(2E)-N-ethyl-2-(1-methoxyethenyl)-4-methylpenta-2,4-dienamide is sourced from PubChem (CID 144830314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).