About 3-[amino(methyl)amino]-2-(hydroxymethyl)benzonitrile;formohydrazide
3-[amino(methyl)amino]-2-(hydroxymethyl)benzonitrile;formohydrazide (PubChem CID 144830652) has the molecular formula C10H15N5O2
and a molecular weight of 237.26 g/mol. Its IUPAC name is 3-[amino(methyl)amino]-2-(hydroxymethyl)benzonitrile;formohydrazide.
Molecular Properties
| Compound Name | 3-[amino(methyl)amino]-2-(hydroxymethyl)benzonitrile;formohydrazide |
| PubChem CID | 144830652 |
| Molecular Formula | C10H15N5O2 |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | 3-[amino(methyl)amino]-2-(hydroxymethyl)benzonitrile;formohydrazide |
| SMILES | CN(N)c1cccc(C#N)c1CO.NNC=O |
| InChI | InChI=1S/C9H11N3O.CH4N2O/c1-12(11)9-4-2-3-7(5-10)8(9)6-13;2-3-1-4/h2-4,13H,6,11H2,1H3;1H,2H2,(H,3,4) |
| InChIKey | MUVDHPKAPTUVCT-UHFFFAOYSA-N |
| XLogP | -1.03 |
| TPSA | 128.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-[amino(methyl)amino]-2-(hydroxymethyl)benzonitrile;formohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[amino(methyl)amino]-2-(hydroxymethyl)benzonitrile;formohydrazide?
The IUPAC name of 3-[amino(methyl)amino]-2-(hydroxymethyl)benzonitrile;formohydrazide (CID 144830652) is 3-[amino(methyl)amino]-2-(hydroxymethyl)benzonitrile;formohydrazide.
What is the SMILES notation for 3-[amino(methyl)amino]-2-(hydroxymethyl)benzonitrile;formohydrazide?
The canonical SMILES for 3-[amino(methyl)amino]-2-(hydroxymethyl)benzonitrile;formohydrazide is CN(N)c1cccc(C#N)c1CO.NNC=O.
What is the InChIKey of 3-[amino(methyl)amino]-2-(hydroxymethyl)benzonitrile;formohydrazide?
The InChIKey is MUVDHPKAPTUVCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N3O.CH4N2O/c1-12(11)9-4-2-3-7(5-10)8(9)6-13;2-3-1-4/h2-4,13H,6,11H2,1H3;1H,2H2,(H,3,4).
What are the key properties of 3-[amino(methyl)amino]-2-(hydroxymethyl)benzonitrile;formohydrazide?
3-[amino(methyl)amino]-2-(hydroxymethyl)benzonitrile;formohydrazide has a molecular weight of 237.26 g/mol, XLogP of -1.03, 3 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[amino(methyl)amino]-2-(hydroxymethyl)benzonitrile;formohydrazide is sourced from PubChem (CID 144830652), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).