About 2-(3,6-dimethyldibenzofuran-4-yl)-1,2-dihydropyridine
2-(3,6-dimethyldibenzofuran-4-yl)-1,2-dihydropyridine (PubChem CID 144831184) has the molecular formula C19H17NO
and a molecular weight of 275.35 g/mol. Its IUPAC name is 2-(3,6-dimethyldibenzofuran-4-yl)-1,2-dihydropyridine.
Molecular Properties
| Compound Name | 2-(3,6-dimethyldibenzofuran-4-yl)-1,2-dihydropyridine |
| PubChem CID | 144831184 |
| Molecular Formula | C19H17NO |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | 2-(3,6-dimethyldibenzofuran-4-yl)-1,2-dihydropyridine |
| SMILES | Cc1ccc2c(oc3c(C)cccc32)c1C1C=CC=CN1 |
| InChI | InChI=1S/C19H17NO/c1-12-9-10-15-14-7-5-6-13(2)18(14)21-19(15)17(12)16-8-3-4-11-20-16/h3-11,16,20H,1-2H3 |
| InChIKey | DLUUAXBGENLVBV-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(3,6-dimethyldibenzofuran-4-yl)-1,2-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,6-dimethyldibenzofuran-4-yl)-1,2-dihydropyridine?
The IUPAC name of 2-(3,6-dimethyldibenzofuran-4-yl)-1,2-dihydropyridine (CID 144831184) is 2-(3,6-dimethyldibenzofuran-4-yl)-1,2-dihydropyridine.
What is the SMILES notation for 2-(3,6-dimethyldibenzofuran-4-yl)-1,2-dihydropyridine?
The canonical SMILES for 2-(3,6-dimethyldibenzofuran-4-yl)-1,2-dihydropyridine is Cc1ccc2c(oc3c(C)cccc32)c1C1C=CC=CN1.
What is the InChIKey of 2-(3,6-dimethyldibenzofuran-4-yl)-1,2-dihydropyridine?
The InChIKey is DLUUAXBGENLVBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17NO/c1-12-9-10-15-14-7-5-6-13(2)18(14)21-19(15)17(12)16-8-3-4-11-20-16/h3-11,16,20H,1-2H3.
What are the key properties of 2-(3,6-dimethyldibenzofuran-4-yl)-1,2-dihydropyridine?
2-(3,6-dimethyldibenzofuran-4-yl)-1,2-dihydropyridine has a molecular weight of 275.35 g/mol, XLogP of 4.92, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,6-dimethyldibenzofuran-4-yl)-1,2-dihydropyridine is sourced from PubChem (CID 144831184), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).