C12H8N4O — CID 144831428
4-methyl-4,5,10,12-tetrazatetracyclo[6.6.1.02,6.011,15]pentadeca-1(15),2,5,8,10,13-hexaen-7-one (PubChem CID 144831428) has the molecular formula C12H8N4O and a molecular weight of 224.22 g/mol. Its IUPAC name is 4-methyl-4,5,10,12-tetrazatetracyclo[6.6.1.02,6.011,15]pentadeca-1(15),2,5,8,10,13-hexaen-7-one.
| Compound Name | 4-methyl-4,5,10,12-tetrazatetracyclo[6.6.1.02,6.011,15]pentadeca-1(15),2,5,8,10,13-hexaen-7-one |
|---|---|
| PubChem CID | 144831428 |
| Molecular Formula | C12H8N4O |
| Molecular Weight | 224.22 g/mol |
| Exact Mass | 224.07 |
| IUPAC Name | 4-methyl-4,5,10,12-tetrazatetracyclo[6.6.1.02,6.011,15]pentadeca-1(15),2,5,8,10,13-hexaen-7-one |
| SMILES | Cn1cc2c(n1)c(=O)c1cnc3[nH]ccc2c31 |
| InChI | InChI=1S/C12H8N4O/c1-16-5-8-6-2-3-13-12-9(6)7(4-14-12)11(17)10(8)15-16/h2-5H,1H3,(H,13,14) |
| InChIKey | RZPDUCORYCWQCC-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.22 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |