C22H23N7OS — CID 144832009
2-[[5-[6-[2-(1,3-benzothiazol-4-yl)propylamino]pyrimidin-4-yl]-3-methanimidoyl-2-pyridinyl]amino]ethanol (PubChem CID 144832009) has the molecular formula C22H23N7OS and a molecular weight of 433.54 g/mol. Its IUPAC name is 2-[[5-[6-[2-(1,3-benzothiazol-4-yl)propylamino]pyrimidin-4-yl]-3-methanimidoyl-2-pyridinyl]amino]ethanol.
| Compound Name | 2-[[5-[6-[2-(1,3-benzothiazol-4-yl)propylamino]pyrimidin-4-yl]-3-methanimidoyl-2-pyridinyl]amino]ethanol |
|---|---|
| PubChem CID | 144832009 |
| Molecular Formula | C22H23N7OS |
| Molecular Weight | 433.54 g/mol |
| Exact Mass | 433.17 |
| IUPAC Name | 2-[[5-[6-[2-(1,3-benzothiazol-4-yl)propylamino]pyrimidin-4-yl]-3-methanimidoyl-2-pyridinyl]amino]ethanol |
| SMILES | [H]/N=C/c1cc(-c2cc(NCC(C)c3cccc4scnc34)ncn2)cnc1NCCO |
| InChI | InChI=1S/C22H23N7OS/c1-14(17-3-2-4-19-21(17)29-13-31-19)10-25-20-8-18(27-12-28-20)16-7-15(9-23)22(26-11-16)24-5-6-30/h2-4,7-9,11-14,23,30H,5-6,10H2,1H3,(H,24,26)(H,25,27,28)/b23-9+ |
| InChIKey | NDJGLMPVEGYYKG-NUGSKGIGSA-N |
| XLogP | 3.77 |
| TPSA | 119.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.54 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|