C21H19F2N5O — CID 144832228
3-[4-amino-6-[(6-fluoro-1,2,3,4-tetrahydronaphthalen-1-yl)amino]pyrimidine-5-carboximidoyl]-5-fluorophenol (PubChem CID 144832228) has the molecular formula C21H19F2N5O and a molecular weight of 395.41 g/mol. Its IUPAC name is 3-[4-amino-6-[(6-fluoro-1,2,3,4-tetrahydronaphthalen-1-yl)amino]pyrimidine-5-carboximidoyl]-5-fluorophenol.
| Compound Name | 3-[4-amino-6-[(6-fluoro-1,2,3,4-tetrahydronaphthalen-1-yl)amino]pyrimidine-5-carboximidoyl]-5-fluorophenol |
|---|---|
| PubChem CID | 144832228 |
| Molecular Formula | C21H19F2N5O |
| Molecular Weight | 395.41 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | 3-[4-amino-6-[(6-fluoro-1,2,3,4-tetrahydronaphthalen-1-yl)amino]pyrimidine-5-carboximidoyl]-5-fluorophenol |
| SMILES | [H]/N=C(\c1cc(O)cc(F)c1)c1c(N)ncnc1NC1CCCc2cc(F)ccc21 |
| InChI | InChI=1S/C21H19F2N5O/c22-13-4-5-16-11(6-13)2-1-3-17(16)28-21-18(20(25)26-10-27-21)19(24)12-7-14(23)9-15(29)8-12/h4-10,17,24,29H,1-3H2,(H3,25,26,27,28)/b24-19+ |
| InChIKey | XQOHHOPEVIQYFC-LYBHJNIJSA-N |
| XLogP | 3.95 |
| TPSA | 107.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.41 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|