About ethane;methylphosphane;(Z)-N-(3-methyl-1H-pyrrol-2-yl)prop-2-en-1-imine
ethane;methylphosphane;(Z)-N-(3-methyl-1H-pyrrol-2-yl)prop-2-en-1-imine (PubChem CID 144832505) has the molecular formula C11H21N2P
and a molecular weight of 212.28 g/mol. Its IUPAC name is ethane;methylphosphane;(Z)-N-(3-methyl-1H-pyrrol-2-yl)prop-2-en-1-imine.
Molecular Properties
| Compound Name | ethane;methylphosphane;(Z)-N-(3-methyl-1H-pyrrol-2-yl)prop-2-en-1-imine |
| PubChem CID | 144832505 |
| Molecular Formula | C11H21N2P |
| Molecular Weight | 212.28 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | ethane;methylphosphane;(Z)-N-(3-methyl-1H-pyrrol-2-yl)prop-2-en-1-imine |
| SMILES | C=C/C=N\c1[nH]ccc1C.CC.CP |
| InChI | InChI=1S/C8H10N2.C2H6.CH5P/c1-3-5-9-8-7(2)4-6-10-8;2*1-2/h3-6,10H,1H2,2H3;1-2H3;2H2,1H3/b9-5-;; |
| InChIKey | WWHBIUIYRLMOHK-XDYVNXDCSA-N |
| XLogP | 3.73 |
| TPSA | 28.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.28 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze ethane;methylphosphane;(Z)-N-(3-methyl-1H-pyrrol-2-yl)prop-2-en-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methylphosphane;(Z)-N-(3-methyl-1H-pyrrol-2-yl)prop-2-en-1-imine?
The IUPAC name of ethane;methylphosphane;(Z)-N-(3-methyl-1H-pyrrol-2-yl)prop-2-en-1-imine (CID 144832505) is ethane;methylphosphane;(Z)-N-(3-methyl-1H-pyrrol-2-yl)prop-2-en-1-imine.
What is the SMILES notation for ethane;methylphosphane;(Z)-N-(3-methyl-1H-pyrrol-2-yl)prop-2-en-1-imine?
The canonical SMILES for ethane;methylphosphane;(Z)-N-(3-methyl-1H-pyrrol-2-yl)prop-2-en-1-imine is C=C/C=N\c1[nH]ccc1C.CC.CP.
What is the InChIKey of ethane;methylphosphane;(Z)-N-(3-methyl-1H-pyrrol-2-yl)prop-2-en-1-imine?
The InChIKey is WWHBIUIYRLMOHK-XDYVNXDCSA-N. The full InChI is InChI=1S/C8H10N2.C2H6.CH5P/c1-3-5-9-8-7(2)4-6-10-8;2*1-2/h3-6,10H,1H2,2H3;1-2H3;2H2,1H3/b9-5-;;.
What are the key properties of ethane;methylphosphane;(Z)-N-(3-methyl-1H-pyrrol-2-yl)prop-2-en-1-imine?
ethane;methylphosphane;(Z)-N-(3-methyl-1H-pyrrol-2-yl)prop-2-en-1-imine has a molecular weight of 212.28 g/mol, XLogP of 3.73, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methylphosphane;(Z)-N-(3-methyl-1H-pyrrol-2-yl)prop-2-en-1-imine is sourced from PubChem (CID 144832505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).