C22H27N3O2 — CID 144833570
N-[(2E,4E)-2-methyl-4-[6-[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]-2-oxo-1H-pyrimidin-4-yl]hepta-2,4,6-trienyl]acetamide (PubChem CID 144833570) has the molecular formula C22H27N3O2 and a molecular weight of 365.48 g/mol. Its IUPAC name is N-[(2E,4E)-2-methyl-4-[6-[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]-2-oxo-1H-pyrimidin-4-yl]hepta-2,4,6-trienyl]acetamide.
| Compound Name | N-[(2E,4E)-2-methyl-4-[6-[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]-2-oxo-1H-pyrimidin-4-yl]hepta-2,4,6-trienyl]acetamide |
|---|---|
| PubChem CID | 144833570 |
| Molecular Formula | C22H27N3O2 |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.21 |
| IUPAC Name | N-[(2E,4E)-2-methyl-4-[6-[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]-2-oxo-1H-pyrimidin-4-yl]hepta-2,4,6-trienyl]acetamide |
| SMILES | C=C/C=C(\C=C(/C)CNC(C)=O)c1cc(C(/C=C\C)=C/C=C\C)[nH]c(=O)n1 |
| InChI | InChI=1S/C22H27N3O2/c1-6-9-12-18(10-7-2)20-14-21(25-22(27)24-20)19(11-8-3)13-16(4)15-23-17(5)26/h6-14H,3,15H2,1-2,4-5H3,(H,23,26)(H,24,25,27)/b9-6-,10-7-,16-13+,18-12+,19-11+ |
| InChIKey | JUQSLLVKTXSGLD-GZKRKNPZSA-N |
| XLogP | 3.96 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|