C39H27N3 — CID 144833865
2-[2-[9-[(3E)-hexa-1,3,5-trien-3-yl]carbazol-3-yl]cyclohepta[b]indol-5-yl]-5-methylbenzonitrile (PubChem CID 144833865) has the molecular formula C39H27N3 and a molecular weight of 537.67 g/mol. Its IUPAC name is 2-[2-[9-[(3E)-hexa-1,3,5-trien-3-yl]carbazol-3-yl]cyclohepta[b]indol-5-yl]-5-methylbenzonitrile.
| Compound Name | 2-[2-[9-[(3E)-hexa-1,3,5-trien-3-yl]carbazol-3-yl]cyclohepta[b]indol-5-yl]-5-methylbenzonitrile |
|---|---|
| PubChem CID | 144833865 |
| Molecular Formula | C39H27N3 |
| Molecular Weight | 537.67 g/mol |
| Exact Mass | 537.22 |
| IUPAC Name | 2-[2-[9-[(3E)-hexa-1,3,5-trien-3-yl]carbazol-3-yl]cyclohepta[b]indol-5-yl]-5-methylbenzonitrile |
| SMILES | C=C/C=C(\C=C)n1c2ccccc2c2cc(-c3ccc4c(c3)c3c(n4-c4ccc(C)cc4C#N)C=C=CC=C3)ccc21 |
| InChI | InChI=1S/C39H27N3/c1-4-11-30(5-2)41-36-15-10-9-13-31(36)33-23-27(17-20-38(33)41)28-18-21-39-34(24-28)32-12-7-6-8-14-37(32)42(39)35-19-16-26(3)22-29(35)25-40/h4-7,9-24H,1-2H2,3H3/b30-11+ |
| InChIKey | KXHWIVWHZMOEGV-KNBZMSCYSA-N |
| XLogP | 9.99 |
| TPSA | 33.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.67 |
| LogP ≤ 5 | 9.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|