About 6-methyl-3-[(1Z,3Z)-3-methylpenta-1,3-dienyl]-1H-indene
6-methyl-3-[(1Z,3Z)-3-methylpenta-1,3-dienyl]-1H-indene (PubChem CID 144834022) has the molecular formula C16H18
and a molecular weight of 210.32 g/mol. Its IUPAC name is 6-methyl-3-[(1Z,3Z)-3-methylpenta-1,3-dienyl]-1H-indene.
Molecular Properties
| Compound Name | 6-methyl-3-[(1Z,3Z)-3-methylpenta-1,3-dienyl]-1H-indene |
| PubChem CID | 144834022 |
| Molecular Formula | C16H18 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | 6-methyl-3-[(1Z,3Z)-3-methylpenta-1,3-dienyl]-1H-indene |
| SMILES | C/C=C(C)\C=C/C1=CCc2cc(C)ccc21 |
| InChI | InChI=1S/C16H18/c1-4-12(2)5-7-14-8-9-15-11-13(3)6-10-16(14)15/h4-8,10-11H,9H2,1-3H3/b7-5-,12-4- |
| InChIKey | NZPXLSKJAVJDCV-WPSHAJHWSA-N |
| XLogP | 4.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 6-methyl-3-[(1Z,3Z)-3-methylpenta-1,3-dienyl]-1H-indene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-3-[(1Z,3Z)-3-methylpenta-1,3-dienyl]-1H-indene?
The IUPAC name of 6-methyl-3-[(1Z,3Z)-3-methylpenta-1,3-dienyl]-1H-indene (CID 144834022) is 6-methyl-3-[(1Z,3Z)-3-methylpenta-1,3-dienyl]-1H-indene.
What is the SMILES notation for 6-methyl-3-[(1Z,3Z)-3-methylpenta-1,3-dienyl]-1H-indene?
The canonical SMILES for 6-methyl-3-[(1Z,3Z)-3-methylpenta-1,3-dienyl]-1H-indene is C/C=C(C)\C=C/C1=CCc2cc(C)ccc21.
What is the InChIKey of 6-methyl-3-[(1Z,3Z)-3-methylpenta-1,3-dienyl]-1H-indene?
The InChIKey is NZPXLSKJAVJDCV-WPSHAJHWSA-N. The full InChI is InChI=1S/C16H18/c1-4-12(2)5-7-14-8-9-15-11-13(3)6-10-16(14)15/h4-8,10-11H,9H2,1-3H3/b7-5-,12-4-.
What are the key properties of 6-methyl-3-[(1Z,3Z)-3-methylpenta-1,3-dienyl]-1H-indene?
6-methyl-3-[(1Z,3Z)-3-methylpenta-1,3-dienyl]-1H-indene has a molecular weight of 210.32 g/mol, XLogP of 4.46, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-3-[(1Z,3Z)-3-methylpenta-1,3-dienyl]-1H-indene is sourced from PubChem (CID 144834022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).