C17H18ClF2N5O2 — CID 144834979
(E)-N-[2-[(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-ethylamino]-2-oxoethyl]-4,4-difluoropent-2-enamide (PubChem CID 144834979) has the molecular formula C17H18ClF2N5O2 and a molecular weight of 397.81 g/mol. Its IUPAC name is (E)-N-[2-[(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-ethylamino]-2-oxoethyl]-4,4-difluoropent-2-enamide.
| Compound Name | (E)-N-[2-[(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-ethylamino]-2-oxoethyl]-4,4-difluoropent-2-enamide |
|---|---|
| PubChem CID | 144834979 |
| Molecular Formula | C17H18ClF2N5O2 |
| Molecular Weight | 397.81 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | (E)-N-[2-[(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-ethylamino]-2-oxoethyl]-4,4-difluoropent-2-enamide |
| SMILES | CCN(C(=O)CNC(=O)/C=C/C(C)(F)F)c1cn(-c2cccnc2)nc1Cl |
| InChI | InChI=1S/C17H18ClF2N5O2/c1-3-24(15(27)10-22-14(26)6-7-17(2,19)20)13-11-25(23-16(13)18)12-5-4-8-21-9-12/h4-9,11H,3,10H2,1-2H3,(H,22,26)/b7-6+ |
| InChIKey | XYTONBDTPRFTJK-VOTSOKGWSA-N |
| XLogP | 2.60 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.81 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|