C25H25N5O2 — CID 144835741
6-[(1R)-5-[(3Z)-3-cyano-4-cyclopropylbuta-1,3-dien-2-yl]-2,5-diazabicyclo[2.2.0]hexan-2-yl]-2-(4-methylphenoxy)pyridine-3-carboxamide (PubChem CID 144835741) has the molecular formula C25H25N5O2 and a molecular weight of 427.51 g/mol. Its IUPAC name is 6-[(1R)-5-[(3Z)-3-cyano-4-cyclopropylbuta-1,3-dien-2-yl]-2,5-diazabicyclo[2.2.0]hexan-2-yl]-2-(4-methylphenoxy)pyridine-3-carboxamide.
| Compound Name | 6-[(1R)-5-[(3Z)-3-cyano-4-cyclopropylbuta-1,3-dien-2-yl]-2,5-diazabicyclo[2.2.0]hexan-2-yl]-2-(4-methylphenoxy)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 144835741 |
| Molecular Formula | C25H25N5O2 |
| Molecular Weight | 427.51 g/mol |
| Exact Mass | 427.20 |
| IUPAC Name | 6-[(1R)-5-[(3Z)-3-cyano-4-cyclopropylbuta-1,3-dien-2-yl]-2,5-diazabicyclo[2.2.0]hexan-2-yl]-2-(4-methylphenoxy)pyridine-3-carboxamide |
| SMILES | C=C(/C(C#N)=C/C1CC1)N1C[C@@H]2C1CN2c1ccc(C(N)=O)c(Oc2ccc(C)cc2)n1 |
| InChI | InChI=1S/C25H25N5O2/c1-15-3-7-19(8-4-15)32-25-20(24(27)31)9-10-23(28-25)30-14-21-22(30)13-29(21)16(2)18(12-26)11-17-5-6-17/h3-4,7-11,17,21-22H,2,5-6,13-14H2,1H3,(H2,27,31)/b18-11+/t21?,22-/m1/s1 |
| InChIKey | ZXNDMTYSLSARAE-HZUZCVDBSA-N |
| XLogP | 3.53 |
| TPSA | 95.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.51 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|