About 7-hydroxy-3,4,8-trimethyl-1H-quinolin-2-one
7-hydroxy-3,4,8-trimethyl-1H-quinolin-2-one (PubChem CID 14483606) has the molecular formula C12H13NO2
and a molecular weight of 203.24 g/mol. Its IUPAC name is 7-hydroxy-3,4,8-trimethyl-1H-quinolin-2-one.
Molecular Properties
| Compound Name | 7-hydroxy-3,4,8-trimethyl-1H-quinolin-2-one |
| PubChem CID | 14483606 |
| Molecular Formula | C12H13NO2 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | 7-hydroxy-3,4,8-trimethyl-1H-quinolin-2-one |
| SMILES | Cc1c(C)c2ccc(O)c(C)c2[nH]c1=O |
| InChI | InChI=1S/C12H13NO2/c1-6-7(2)12(15)13-11-8(3)10(14)5-4-9(6)11/h4-5,14H,1-3H3,(H,13,15) |
| InChIKey | UQMZZJHQNMPPRV-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-hydroxy-3,4,8-trimethyl-1H-quinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-hydroxy-3,4,8-trimethyl-1H-quinolin-2-one?
The IUPAC name of 7-hydroxy-3,4,8-trimethyl-1H-quinolin-2-one (CID 14483606) is 7-hydroxy-3,4,8-trimethyl-1H-quinolin-2-one.
What is the SMILES notation for 7-hydroxy-3,4,8-trimethyl-1H-quinolin-2-one?
The canonical SMILES for 7-hydroxy-3,4,8-trimethyl-1H-quinolin-2-one is Cc1c(C)c2ccc(O)c(C)c2[nH]c1=O.
What is the InChIKey of 7-hydroxy-3,4,8-trimethyl-1H-quinolin-2-one?
The InChIKey is UQMZZJHQNMPPRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NO2/c1-6-7(2)12(15)13-11-8(3)10(14)5-4-9(6)11/h4-5,14H,1-3H3,(H,13,15).
What are the key properties of 7-hydroxy-3,4,8-trimethyl-1H-quinolin-2-one?
7-hydroxy-3,4,8-trimethyl-1H-quinolin-2-one has a molecular weight of 203.24 g/mol, XLogP of 2.16, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-hydroxy-3,4,8-trimethyl-1H-quinolin-2-one is sourced from PubChem (CID 14483606), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).