About N-[(E)-2,3-diethyl-5,5-dimethylhex-1-enyl]methanimine
N-[(E)-2,3-diethyl-5,5-dimethylhex-1-enyl]methanimine (PubChem CID 144837093) has the molecular formula C13H25N
and a molecular weight of 195.35 g/mol. Its IUPAC name is N-[(E)-2,3-diethyl-5,5-dimethylhex-1-enyl]methanimine.
Molecular Properties
| Compound Name | N-[(E)-2,3-diethyl-5,5-dimethylhex-1-enyl]methanimine |
| PubChem CID | 144837093 |
| Molecular Formula | C13H25N |
| Molecular Weight | 195.35 g/mol |
| Exact Mass | 195.20 |
| IUPAC Name | N-[(E)-2,3-diethyl-5,5-dimethylhex-1-enyl]methanimine |
| SMILES | C=N/C=C(\CC)C(CC)CC(C)(C)C |
| InChI | InChI=1S/C13H25N/c1-7-11(9-13(3,4)5)12(8-2)10-14-6/h10-11H,6-9H2,1-5H3/b12-10+ |
| InChIKey | SOSUDCPWQKWROG-ZRDIBKRKSA-N |
| XLogP | 4.44 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.35 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-[(E)-2,3-diethyl-5,5-dimethylhex-1-enyl]methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(E)-2,3-diethyl-5,5-dimethylhex-1-enyl]methanimine?
The IUPAC name of N-[(E)-2,3-diethyl-5,5-dimethylhex-1-enyl]methanimine (CID 144837093) is N-[(E)-2,3-diethyl-5,5-dimethylhex-1-enyl]methanimine.
What is the SMILES notation for N-[(E)-2,3-diethyl-5,5-dimethylhex-1-enyl]methanimine?
The canonical SMILES for N-[(E)-2,3-diethyl-5,5-dimethylhex-1-enyl]methanimine is C=N/C=C(\CC)C(CC)CC(C)(C)C.
What is the InChIKey of N-[(E)-2,3-diethyl-5,5-dimethylhex-1-enyl]methanimine?
The InChIKey is SOSUDCPWQKWROG-ZRDIBKRKSA-N. The full InChI is InChI=1S/C13H25N/c1-7-11(9-13(3,4)5)12(8-2)10-14-6/h10-11H,6-9H2,1-5H3/b12-10+.
What are the key properties of N-[(E)-2,3-diethyl-5,5-dimethylhex-1-enyl]methanimine?
N-[(E)-2,3-diethyl-5,5-dimethylhex-1-enyl]methanimine has a molecular weight of 195.35 g/mol, XLogP of 4.44, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(E)-2,3-diethyl-5,5-dimethylhex-1-enyl]methanimine is sourced from PubChem (CID 144837093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).