C36H24O10 — CID 144837195
6-[7-[10-(2,3,4,5,6-pentahydroxyphenyl)anthracen-9-yl]naphthalen-1-yl]benzene-1,2,3,4,5-pentol (PubChem CID 144837195) has the molecular formula C36H24O10 and a molecular weight of 616.58 g/mol. Its IUPAC name is 6-[7-[10-(2,3,4,5,6-pentahydroxyphenyl)anthracen-9-yl]naphthalen-1-yl]benzene-1,2,3,4,5-pentol.
| Compound Name | 6-[7-[10-(2,3,4,5,6-pentahydroxyphenyl)anthracen-9-yl]naphthalen-1-yl]benzene-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 144837195 |
| Molecular Formula | C36H24O10 |
| Molecular Weight | 616.58 g/mol |
| Exact Mass | 616.14 |
| IUPAC Name | 6-[7-[10-(2,3,4,5,6-pentahydroxyphenyl)anthracen-9-yl]naphthalen-1-yl]benzene-1,2,3,4,5-pentol |
| SMILES | Oc1c(O)c(O)c(-c2cccc3ccc(-c4c5ccccc5c(-c5c(O)c(O)c(O)c(O)c5O)c5ccccc45)cc23)c(O)c1O |
| InChI | InChI=1S/C36H24O10/c37-27-25(28(38)32(42)35(45)31(27)41)21-11-5-6-15-12-13-16(14-22(15)21)23-17-7-1-3-9-19(17)24(20-10-4-2-8-18(20)23)26-29(39)33(43)36(46)34(44)30(26)40/h1-14,37-46H |
| InChIKey | XTZGRMLDVKKQPE-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 202.30 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.58 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|