C57H42O4 — CID 144837448
(3Z,5Z)-6-[10-[8-[3-(2,3-dihydronaphthalen-2-yl)-5-naphthalen-2-ylphenyl]naphthalen-2-yl]anthracen-9-yl]hepta-1,3,5-triene-2,3,4,5-tetrol (PubChem CID 144837448) has the molecular formula C57H42O4 and a molecular weight of 790.96 g/mol. Its IUPAC name is (3Z,5Z)-6-[10-[8-[3-(2,3-dihydronaphthalen-2-yl)-5-naphthalen-2-ylphenyl]naphthalen-2-yl]anthracen-9-yl]hepta-1,3,5-triene-2,3,4,5-tetrol.
| Compound Name | (3Z,5Z)-6-[10-[8-[3-(2,3-dihydronaphthalen-2-yl)-5-naphthalen-2-ylphenyl]naphthalen-2-yl]anthracen-9-yl]hepta-1,3,5-triene-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 144837448 |
| Molecular Formula | C57H42O4 |
| Molecular Weight | 790.96 g/mol |
| Exact Mass | 790.31 |
| IUPAC Name | (3Z,5Z)-6-[10-[8-[3-(2,3-dihydronaphthalen-2-yl)-5-naphthalen-2-ylphenyl]naphthalen-2-yl]anthracen-9-yl]hepta-1,3,5-triene-2,3,4,5-tetrol |
| SMILES | C=C(O)/C(O)=C(O)\C(O)=C(/C)c1c2ccccc2c(-c2ccc3cccc(-c4cc(-c5ccc6ccccc6c5)cc(C5C=c6ccccc6=CC5)c4)c3c2)c2ccccc12 |
| InChI | InChI=1S/C57H42O4/c1-34(55(59)57(61)56(60)35(2)58)53-48-17-7-9-19-50(48)54(51-20-10-8-18-49(51)53)43-27-24-38-16-11-21-47(52(38)33-43)46-31-44(41-25-22-36-12-3-5-14-39(36)28-41)30-45(32-46)42-26-23-37-13-4-6-15-40(37)29-42/h3-25,27-33,42,58-61H,2,26H2,1H3/b55-34-,57-56- |
| InChIKey | ZFXNXEIJQZIFHN-ZVQZDYMFSA-N |
| XLogP | 13.74 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 790.96 |
| LogP ≤ 5 | 13.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|