About 4-[(3E)-penta-1,3-dien-3-yl]benzenesulfinate
4-[(3E)-penta-1,3-dien-3-yl]benzenesulfinate (PubChem CID 144837495) has the molecular formula C11H11O2S-
and a molecular weight of 207.27 g/mol. Its IUPAC name is 4-[(3E)-penta-1,3-dien-3-yl]benzenesulfinate.
Molecular Properties
| Compound Name | 4-[(3E)-penta-1,3-dien-3-yl]benzenesulfinate |
| PubChem CID | 144837495 |
| Molecular Formula | C11H11O2S- |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.05 |
| IUPAC Name | 4-[(3E)-penta-1,3-dien-3-yl]benzenesulfinate |
| SMILES | C=C/C(=C\C)c1ccc(S(=O)[O-])cc1 |
| InChI | InChI=1S/C11H12O2S/c1-3-9(4-2)10-5-7-11(8-6-10)14(12)13/h3-8H,1H2,2H3,(H,12,13)/p-1/b9-4+ |
| InChIKey | YFWFYUCDEHWIHX-RUDMXATFSA-M |
| XLogP | 2.51 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze 4-[(3E)-penta-1,3-dien-3-yl]benzenesulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(3E)-penta-1,3-dien-3-yl]benzenesulfinate?
The IUPAC name of 4-[(3E)-penta-1,3-dien-3-yl]benzenesulfinate (CID 144837495) is 4-[(3E)-penta-1,3-dien-3-yl]benzenesulfinate.
What is the SMILES notation for 4-[(3E)-penta-1,3-dien-3-yl]benzenesulfinate?
The canonical SMILES for 4-[(3E)-penta-1,3-dien-3-yl]benzenesulfinate is C=C/C(=C\C)c1ccc(S(=O)[O-])cc1.
What is the InChIKey of 4-[(3E)-penta-1,3-dien-3-yl]benzenesulfinate?
The InChIKey is YFWFYUCDEHWIHX-RUDMXATFSA-M. The full InChI is InChI=1S/C11H12O2S/c1-3-9(4-2)10-5-7-11(8-6-10)14(12)13/h3-8H,1H2,2H3,(H,12,13)/p-1/b9-4+.
What are the key properties of 4-[(3E)-penta-1,3-dien-3-yl]benzenesulfinate?
4-[(3E)-penta-1,3-dien-3-yl]benzenesulfinate has a molecular weight of 207.27 g/mol, XLogP of 2.51, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3E)-penta-1,3-dien-3-yl]benzenesulfinate is sourced from PubChem (CID 144837495), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).