About 1-[3-ethyl-2-[(E)-2-(4-fluorofuran-2-yl)ethenyl]phenyl]-1-methylhydrazine;formohydrazide
1-[3-ethyl-2-[(E)-2-(4-fluorofuran-2-yl)ethenyl]phenyl]-1-methylhydrazine;formohydrazide (PubChem CID 144837932) has the molecular formula C16H21FN4O2
and a molecular weight of 320.37 g/mol. Its IUPAC name is 1-[3-ethyl-2-[(E)-2-(4-fluorofuran-2-yl)ethenyl]phenyl]-1-methylhydrazine;formohydrazide.
Molecular Properties
| Compound Name | 1-[3-ethyl-2-[(E)-2-(4-fluorofuran-2-yl)ethenyl]phenyl]-1-methylhydrazine;formohydrazide |
| PubChem CID | 144837932 |
| Molecular Formula | C16H21FN4O2 |
| Molecular Weight | 320.37 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | 1-[3-ethyl-2-[(E)-2-(4-fluorofuran-2-yl)ethenyl]phenyl]-1-methylhydrazine;formohydrazide |
| SMILES | CCc1cccc(N(C)N)c1/C=C/c1cc(F)co1.NNC=O |
| InChI | InChI=1S/C15H17FN2O.CH4N2O/c1-3-11-5-4-6-15(18(2)17)14(11)8-7-13-9-12(16)10-19-13;2-3-1-4/h4-10H,3,17H2,1-2H3;1H,2H2,(H,3,4)/b8-7+; |
| InChIKey | IDTLYWPWMFPEPB-USRGLUTNSA-N |
| XLogP | 2.07 |
| TPSA | 97.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.37 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[3-ethyl-2-[(E)-2-(4-fluorofuran-2-yl)ethenyl]phenyl]-1-methylhydrazine;formohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-ethyl-2-[(E)-2-(4-fluorofuran-2-yl)ethenyl]phenyl]-1-methylhydrazine;formohydrazide?
The IUPAC name of 1-[3-ethyl-2-[(E)-2-(4-fluorofuran-2-yl)ethenyl]phenyl]-1-methylhydrazine;formohydrazide (CID 144837932) is 1-[3-ethyl-2-[(E)-2-(4-fluorofuran-2-yl)ethenyl]phenyl]-1-methylhydrazine;formohydrazide.
What is the SMILES notation for 1-[3-ethyl-2-[(E)-2-(4-fluorofuran-2-yl)ethenyl]phenyl]-1-methylhydrazine;formohydrazide?
The canonical SMILES for 1-[3-ethyl-2-[(E)-2-(4-fluorofuran-2-yl)ethenyl]phenyl]-1-methylhydrazine;formohydrazide is CCc1cccc(N(C)N)c1/C=C/c1cc(F)co1.NNC=O.
What is the InChIKey of 1-[3-ethyl-2-[(E)-2-(4-fluorofuran-2-yl)ethenyl]phenyl]-1-methylhydrazine;formohydrazide?
The InChIKey is IDTLYWPWMFPEPB-USRGLUTNSA-N. The full InChI is InChI=1S/C15H17FN2O.CH4N2O/c1-3-11-5-4-6-15(18(2)17)14(11)8-7-13-9-12(16)10-19-13;2-3-1-4/h4-10H,3,17H2,1-2H3;1H,2H2,(H,3,4)/b8-7+;.
What are the key properties of 1-[3-ethyl-2-[(E)-2-(4-fluorofuran-2-yl)ethenyl]phenyl]-1-methylhydrazine;formohydrazide?
1-[3-ethyl-2-[(E)-2-(4-fluorofuran-2-yl)ethenyl]phenyl]-1-methylhydrazine;formohydrazide has a molecular weight of 320.37 g/mol, XLogP of 2.07, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-ethyl-2-[(E)-2-(4-fluorofuran-2-yl)ethenyl]phenyl]-1-methylhydrazine;formohydrazide is sourced from PubChem (CID 144837932), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).