About ethenylhydrazine;2-(furan-2-ylmethylsulfanyl)-N-methyl-3-(trifluoromethyl)aniline
ethenylhydrazine;2-(furan-2-ylmethylsulfanyl)-N-methyl-3-(trifluoromethyl)aniline (PubChem CID 144838082) has the molecular formula C15H18F3N3OS
and a molecular weight of 345.39 g/mol. Its IUPAC name is ethenylhydrazine;2-(furan-2-ylmethylsulfanyl)-N-methyl-3-(trifluoromethyl)aniline.
Molecular Properties
| Compound Name | ethenylhydrazine;2-(furan-2-ylmethylsulfanyl)-N-methyl-3-(trifluoromethyl)aniline |
| PubChem CID | 144838082 |
| Molecular Formula | C15H18F3N3OS |
| Molecular Weight | 345.39 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | ethenylhydrazine;2-(furan-2-ylmethylsulfanyl)-N-methyl-3-(trifluoromethyl)aniline |
| SMILES | C=CNN.CNc1cccc(C(F)(F)F)c1SCc1ccco1 |
| InChI | InChI=1S/C13H12F3NOS.C2H6N2/c1-17-11-6-2-5-10(13(14,15)16)12(11)19-8-9-4-3-7-18-9;1-2-4-3/h2-7,17H,8H2,1H3;2,4H,1,3H2 |
| InChIKey | FIAYYLCTRPRGCZ-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 63.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.39 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethenylhydrazine;2-(furan-2-ylmethylsulfanyl)-N-methyl-3-(trifluoromethyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethenylhydrazine;2-(furan-2-ylmethylsulfanyl)-N-methyl-3-(trifluoromethyl)aniline?
The IUPAC name of ethenylhydrazine;2-(furan-2-ylmethylsulfanyl)-N-methyl-3-(trifluoromethyl)aniline (CID 144838082) is ethenylhydrazine;2-(furan-2-ylmethylsulfanyl)-N-methyl-3-(trifluoromethyl)aniline.
What is the SMILES notation for ethenylhydrazine;2-(furan-2-ylmethylsulfanyl)-N-methyl-3-(trifluoromethyl)aniline?
The canonical SMILES for ethenylhydrazine;2-(furan-2-ylmethylsulfanyl)-N-methyl-3-(trifluoromethyl)aniline is C=CNN.CNc1cccc(C(F)(F)F)c1SCc1ccco1.
What is the InChIKey of ethenylhydrazine;2-(furan-2-ylmethylsulfanyl)-N-methyl-3-(trifluoromethyl)aniline?
The InChIKey is FIAYYLCTRPRGCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12F3NOS.C2H6N2/c1-17-11-6-2-5-10(13(14,15)16)12(11)19-8-9-4-3-7-18-9;1-2-4-3/h2-7,17H,8H2,1H3;2,4H,1,3H2.
What are the key properties of ethenylhydrazine;2-(furan-2-ylmethylsulfanyl)-N-methyl-3-(trifluoromethyl)aniline?
ethenylhydrazine;2-(furan-2-ylmethylsulfanyl)-N-methyl-3-(trifluoromethyl)aniline has a molecular weight of 345.39 g/mol, XLogP of 4.23, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethenylhydrazine;2-(furan-2-ylmethylsulfanyl)-N-methyl-3-(trifluoromethyl)aniline is sourced from PubChem (CID 144838082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).