About 3-bromo-N-methyl-2-[(E)-2-[4-(trifluoromethyl)furan-2-yl]ethenyl]aniline;formohydrazide
3-bromo-N-methyl-2-[(E)-2-[4-(trifluoromethyl)furan-2-yl]ethenyl]aniline;formohydrazide (PubChem CID 144838111) has the molecular formula C15H15BrF3N3O2
and a molecular weight of 406.20 g/mol. Its IUPAC name is 3-bromo-N-methyl-2-[(E)-2-[4-(trifluoromethyl)furan-2-yl]ethenyl]aniline;formohydrazide.
Molecular Properties
| Compound Name | 3-bromo-N-methyl-2-[(E)-2-[4-(trifluoromethyl)furan-2-yl]ethenyl]aniline;formohydrazide |
| PubChem CID | 144838111 |
| Molecular Formula | C15H15BrF3N3O2 |
| Molecular Weight | 406.20 g/mol |
| Exact Mass | 405.03 |
| IUPAC Name | 3-bromo-N-methyl-2-[(E)-2-[4-(trifluoromethyl)furan-2-yl]ethenyl]aniline;formohydrazide |
| SMILES | CNc1cccc(Br)c1/C=C/c1cc(C(F)(F)F)co1.NNC=O |
| InChI | InChI=1S/C14H11BrF3NO.CH4N2O/c1-19-13-4-2-3-12(15)11(13)6-5-10-7-9(8-20-10)14(16,17)18;2-3-1-4/h2-8,19H,1H3;1H,2H2,(H,3,4)/b6-5+; |
| InChIKey | FMUYABQBYYVXEU-IPZCTEOASA-N |
| XLogP | 3.88 |
| TPSA | 80.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.20 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-bromo-N-methyl-2-[(E)-2-[4-(trifluoromethyl)furan-2-yl]ethenyl]aniline;formohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-N-methyl-2-[(E)-2-[4-(trifluoromethyl)furan-2-yl]ethenyl]aniline;formohydrazide?
The IUPAC name of 3-bromo-N-methyl-2-[(E)-2-[4-(trifluoromethyl)furan-2-yl]ethenyl]aniline;formohydrazide (CID 144838111) is 3-bromo-N-methyl-2-[(E)-2-[4-(trifluoromethyl)furan-2-yl]ethenyl]aniline;formohydrazide.
What is the SMILES notation for 3-bromo-N-methyl-2-[(E)-2-[4-(trifluoromethyl)furan-2-yl]ethenyl]aniline;formohydrazide?
The canonical SMILES for 3-bromo-N-methyl-2-[(E)-2-[4-(trifluoromethyl)furan-2-yl]ethenyl]aniline;formohydrazide is CNc1cccc(Br)c1/C=C/c1cc(C(F)(F)F)co1.NNC=O.
What is the InChIKey of 3-bromo-N-methyl-2-[(E)-2-[4-(trifluoromethyl)furan-2-yl]ethenyl]aniline;formohydrazide?
The InChIKey is FMUYABQBYYVXEU-IPZCTEOASA-N. The full InChI is InChI=1S/C14H11BrF3NO.CH4N2O/c1-19-13-4-2-3-12(15)11(13)6-5-10-7-9(8-20-10)14(16,17)18;2-3-1-4/h2-8,19H,1H3;1H,2H2,(H,3,4)/b6-5+;.
What are the key properties of 3-bromo-N-methyl-2-[(E)-2-[4-(trifluoromethyl)furan-2-yl]ethenyl]aniline;formohydrazide?
3-bromo-N-methyl-2-[(E)-2-[4-(trifluoromethyl)furan-2-yl]ethenyl]aniline;formohydrazide has a molecular weight of 406.20 g/mol, XLogP of 3.88, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-N-methyl-2-[(E)-2-[4-(trifluoromethyl)furan-2-yl]ethenyl]aniline;formohydrazide is sourced from PubChem (CID 144838111), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).