About 3-bromo-N-methyl-2-[(5-methyl-2-pyridinyl)methylsulfanyl]aniline;formohydrazide
3-bromo-N-methyl-2-[(5-methyl-2-pyridinyl)methylsulfanyl]aniline;formohydrazide (PubChem CID 144838366) has the molecular formula C15H19BrN4OS
and a molecular weight of 383.32 g/mol. Its IUPAC name is 3-bromo-N-methyl-2-[(5-methyl-2-pyridinyl)methylsulfanyl]aniline;formohydrazide.
Molecular Properties
| Compound Name | 3-bromo-N-methyl-2-[(5-methyl-2-pyridinyl)methylsulfanyl]aniline;formohydrazide |
| PubChem CID | 144838366 |
| Molecular Formula | C15H19BrN4OS |
| Molecular Weight | 383.32 g/mol |
| Exact Mass | 382.05 |
| IUPAC Name | 3-bromo-N-methyl-2-[(5-methyl-2-pyridinyl)methylsulfanyl]aniline;formohydrazide |
| SMILES | CNc1cccc(Br)c1SCc1ccc(C)cn1.NNC=O |
| InChI | InChI=1S/C14H15BrN2S.CH4N2O/c1-10-6-7-11(17-8-10)9-18-14-12(15)4-3-5-13(14)16-2;2-3-1-4/h3-8,16H,9H2,1-2H3;1H,2H2,(H,3,4) |
| InChIKey | ZOHHGAZWEREDCT-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.32 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-bromo-N-methyl-2-[(5-methyl-2-pyridinyl)methylsulfanyl]aniline;formohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-N-methyl-2-[(5-methyl-2-pyridinyl)methylsulfanyl]aniline;formohydrazide?
The IUPAC name of 3-bromo-N-methyl-2-[(5-methyl-2-pyridinyl)methylsulfanyl]aniline;formohydrazide (CID 144838366) is 3-bromo-N-methyl-2-[(5-methyl-2-pyridinyl)methylsulfanyl]aniline;formohydrazide.
What is the SMILES notation for 3-bromo-N-methyl-2-[(5-methyl-2-pyridinyl)methylsulfanyl]aniline;formohydrazide?
The canonical SMILES for 3-bromo-N-methyl-2-[(5-methyl-2-pyridinyl)methylsulfanyl]aniline;formohydrazide is CNc1cccc(Br)c1SCc1ccc(C)cn1.NNC=O.
What is the InChIKey of 3-bromo-N-methyl-2-[(5-methyl-2-pyridinyl)methylsulfanyl]aniline;formohydrazide?
The InChIKey is ZOHHGAZWEREDCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15BrN2S.CH4N2O/c1-10-6-7-11(17-8-10)9-18-14-12(15)4-3-5-13(14)16-2;2-3-1-4/h3-8,16H,9H2,1-2H3;1H,2H2,(H,3,4).
What are the key properties of 3-bromo-N-methyl-2-[(5-methyl-2-pyridinyl)methylsulfanyl]aniline;formohydrazide?
3-bromo-N-methyl-2-[(5-methyl-2-pyridinyl)methylsulfanyl]aniline;formohydrazide has a molecular weight of 383.32 g/mol, XLogP of 3.09, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-N-methyl-2-[(5-methyl-2-pyridinyl)methylsulfanyl]aniline;formohydrazide is sourced from PubChem (CID 144838366), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).